The committee was established in 1954 by the American Standards Association (ASA), which became the USA Standards Institute and then the American National Standards Institute (ANSI).
The common names were published as separate standards that were withdrawn after five or 10 years, unless they were reaffirmed or revised.
The committee was disbanded in 1997, so by the end of 2007 all of the standards had been withdrawn.
A few ANSI names were not ISO names and did not have ISO equivalents: amidochlor, cisanilide, dicapthon, ethephon, flupyrazofos, lactofen, parinol, swep and zoalene (a coccidiostat). The eight relevant names have now been adopted for inclusion in ISO 1750 and will be included in the XML data set for ISO 1750:2026.
| Number | Systematic name in title of standard | Common name | ISO |
|---|---|---|---|
| K62.1-1968 | Procedure for the Acceptance of a USA Standard Common Name for a Pest Control Chemical | ||
| K62.1-1979 | Common name for a pest control chemical – Procedure for acceptance | ||
| K62.1-1985 | Common name for a pest control chemical – Procedure for acceptance | ||
| K62.2-1957 | 3-(p-chlorophenyl)-1,1-dimethylurea | monuron | ✓ |
| K62.3-1957 | 3-(3,4-dichlorophenyl)-1,1-dimethylurea | diuron | ✓ |
| K62.4 | |||
| K62.5 | |||
| K62.6-1957 | 2-(2,4,5-trichlorophenoxy)ethyl 2,2-dichloropropionate | erbon | ✓ |
| K62.7-1958 | 3-phenyl-1,1-dimethylurea | fenuron | ✓ |
| K62.8-1957 | 1-butyl-3-(3,4-dichlorophenyl)-1-methylurea | neburon | ✓ |
| K62.9-1957 | 2,2-dichloropropionic acid | dalapon | ✓ |
| K62.10-1957 | 2-(2,4,5-trichlorophenoxy)propionic acid | silvex | fenoprop |
| K62.11-1957 | p-chlorophenyl p-chlorobenzenesulfonate | ovex | chlorfenson |
| K62.12-1958 | O,O,O′,O′-tetraethyl S,S′-methylene bisphosphorodithioate | ethion | ✓ |
| K62.13-1958 | 2-diphenylacetyl-1,3-indandione | diphacinone | ✓ |
| K62.14-1958 | O-2-chloro-4-nitrophenyl O,O-dimethyl phosphorothioate | dicapthon | none |
| K62.15-1958 | 2-chloro-2-diethylcarbamoyl-1-methylvinyl dimethyl phosphate | phosphamidon | ✓ |
| K62.16-1958 | O,O-dimethyl S-(N-methylcarbamoylmethyl) phosphorodithioate | dimethoate | ✓ |
| K62.17 | |||
| K62.18-1958 | O,O-dimethyl O-2,4,5-trichlorophenyl phosphorothioate | ronnel | fenchlorphos |
| K62.19-1959 | 3,5-dinitro-o-toluamide | zoalene | n/a |
| K62.20-1959 | p-chlorobenzyl p-chlorophenyl sulfide | chlorbenside | ✓ |
| K62.21-1959 | N-dodecylguanidine acetate | dodine | ✓ |
| K62.22-1959 | O,O-diethyl S-(ethylthio)methyl phosphordithioate | phorate | ✓ |
| K62.23-1960 | 4-chloro-2-butynyl m-chlorocarbanilate | barban | ✓ |
| K62.24-1961 | 3-amino-s-triazole | amitrole | ✓ |
| K62.25-1961 | N-(trichloromethylthio)phthalimide | folpet | ✓ |
| K62.26-1961 | 2-chloro-4-ethylamino-6-isopropylamino-s-triazine | atrazine | ✓ |
| K62.27-1961 | 2-chloro-4,6-bis(diethylamino)-s-triazine | chlorazine | ✓ |
| K62.28-1961 | 2-chloro-4,6-bis(ethylamino)-s-triazine | simazine | ✓ |
| K62.29-1961 | 2-chloro-4-diethylamino-6-ethylamino-s-triazine | trietazine | ✓ |
| K62.30-1962 | 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-6,9-methano-2,4,3-benzodioxathiepin 3-oxide | endosulfan | ✓ |
| K62.31-1961 | 4-chlorophenyl 2,4,5-trichlorophenyl sulfone | tetradifon | ✓ |
| K62.32-1962 | 2,4-dimethylbenzyl-2,2-dimethyl-3-(2-methylpropenyl) cyclopropanecarboxylate | dimethrin | ✓ |
| K62.33-1962 | S-[(p-chlorophenylthio)methyl] O,O-diethyl phosphorodithioate | carbophenothion | ✓ |
| K62.34-1962 | 3-(3,4-dichlorophenyl)-1-methoxy-1-methylurea | linuron | ✓ |
| K62.35-1962 | 1,2-dibromo-2,2-dichloroethyl dimethyl phosphate | naled | ✓ |
| K62.36-1962 | 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid | endothall | endothal |
| K62.37-1962 | 3-amino-2,5-dichlorobenzoic acid | amiben | chloramben |
| K62.38-1962 | 1-naphthyl methylcarbamate | carbaryl | ✓ |
| K62.39-1962 | 5-bromo-3-isopropyl-6-methyluracil | isocil | ✓ |
| K62.40-1962 | 2-sec-butyl-4,6-dinitrophenyl 3-methyl-2-butenoate | binapacryl | ✓ |
| K62.41-1962 | S-[(5-methoxy-oxo-4H-pyran-2-yl)methyl] O,O-dimethyl phosphorothioate | endothion | ✓ |
| K62.42-1963 | N,N-dimethyl-2,2-diphenylacetamide | diphenamid | ✓ |
| K62.43-1963 | α,α,α-trifluoro-2,6-dinitro-N,N-dipropyl-p-toluidine | trifluralin | ✓ |
| K62.44-1962 | 6,7-dihydrodipyrido[1,2-a:2′,1′-c]pyrazidiinium salt | diquat | ✓ |
| K62.45-1962 | 1,1′-dimethyl-4,4′-bipyridinium salt | paraquat | ✓ |
| K62.46-1963 | methyl 3,4-dichlorocarbanilate | swep | none |
| K62.47-1963 | 3,4-dichloro-2-methylacrylanilide | dicryl | chloranocryl |
| K62.48-1963 | 3-chloro-2-methyl-p-valerotoluidide | solan | pentanochlor |
| K62.49 | |||
| K62.50-1963 | 5-bromo-3-sec-butyl-6-methyluracil | bromacil | ✓ |
| K62.51 | |||
| K62.52-1963 | 2,6-dichlorobenzonitrile | dichlobenil | ✓ |
| K62.53-1963 | 3-(hexahydro-4,7-methanoindan-5-yl)-1,1-dimethylurea | norea | noruron |
| K62.54-1963 | 2,3-p-dioxanedithiol S,S-bis(O,O-diethyl phosphorodithioate) | dioxathion | ✓ |
| K62.55-1963 | 3,6-dichloro-o-anisic acid | dicamba | ✓ |
| K62.56-1963 | 3,5,6-trichloro-o-anisic acid | tricamba | ✓ |
| K62.57-1964 | 5-(α-hydroxy-α-2-pyridylbenzyl)-7-(α-2-pyridylbenzylidene)-5-norbornene-2,3-dicarboximide | norbormide | ✓ |
| K62.58-1967 | amidithion | ✓ | |
| K62.59-1965 | 3′,4′-dichlorocyclopropanecarboxanilide | cypromid | ✓ |
| K62.60-1965 | 1-(2-methylcyclohexyl)-3-phenylurea | siduron | ✓ |
| K62.61 | |||
| K62.62-1966 | 5-amino 4-chloro-2-phenyl-3(2H)-pyridazinone | pyrazon | chloridazon |
| K62.63-1965 | 3-cyclohexyl-6,7-dihydro-1H-cyclopentapyrimidine-2,4(3H,5H)-dione | lenacil | ✓ |
| K62.64-1966 | 1,4-dichloro-2,5-dimethoxybenzene | chloroneb | ✓ |
| K62.65-1966 | 3,5-dibromo-4-hydroxybenzonitrile | bromoxynil | ✓ |
| K62.66-1966 | 3-tert-butyl-5-chloro-6-methyluracil | terbacil | ✓ |
| K62.67-1967 | O,O-diethyl S-[(6-chloro-2-oxobenzoxazolin-3-yl) methyl] phosphorodithioate | phosalone | ✓ |
| K62.68-1966 | 3,3′-ethylenebis (tetrahydro-4,6-dimethyl-2H-1,3,5-thiadiazine-2-thione) | milneb | ✓ |
| K62.69 | |||
| K62.70-1967 | S-methyl N-[(methylcarbamoyl)oxy]thioacetimidate | methomyl | ✓ |
| K62.71-1968 | m-[[(dimethylamino)methylene]amino)phenyl methylcarbamate | formetanate | ✓ |
| K62.72 | |||
| K62.73-1968 | |||
| K62.74-1968 | 2,3-dihydro-2,2-dimethyl-7-benzofuranyl methylcarbamate | carbofuran | ✓ |
| K62.75-1968 | D-N-ethyllactamide carbanilate (ester) | carbetamide | ✓ |
| K62.76-1968 | parinol | none | |
| K62.77-1968 | 2-methyl-2-(methylthio)propionaldehyde O-(methylcarbamoyl)oxime | aldicarb | ✓ |
| K62.78-1968 | methyl 1-(butylcarbamoyl)-2-benzimidazolecarbamate | benomyl | ✓ |
| K62.79 | |||
| K62.80-1969 | 1,1-dimethyl-3-(α,α,α-trifluoro-m-tolyl)urea | fluometuron | ✓ |
| K62.81 | |||
| K62.82-1969 | 3-(p-bromophenyl)-1-methoxy-1-methylurea | metobromuron | ✓ |
| K62.83-1969 | 3-[p-(p-chlorophenoxy)phenyl]-1,1-dimethylurea | chloroxuron | ✓ |
| K62.84-1969 | 3,5-dinitro-N4,N4-dipropylsulfanilamide | oryzalin | ✓ |
| K62.85-1969 | 3,4-dichlorobenzyl methylcarbamate | dichlormate | ✓ |
| K62.86-1969 | methyl m-hydroxycarbanilate m-methylcarbanilate | phenmedipham | ✓ |
| K62.87-1969 | O,O-diethyl phosphorodithioate S-ester with N-(2-chloro-1-mercaptoethyl)phthalimide | dialifor | dialifos |
| K62.88-1969 | 2-chloro-2′,6-diethyl-N-(methoxymethyl)acetanilide | alachlor | ✓ |
| K62.89-1971 | 2-chloro-N-(isobutoxymethyl)-2′,6′-acetoxylidide | delachlor | ✓ |
| K62.90-1971 | N-(butoxymethyl)-2-chloro-2′,6′-diethylacetanilide | butachlor | ✓ |
| K62.91-1970 | 3-amino-2,5-dichlorobenzoic acid | chloramben | ✓ |
| K62.92-1970 | (2-chloroethyl)phosphonic acid | ethephon | none |
| K62.93 | |||
| K62.94-1970 | tert-butylcarbamic acid ester with 3-(m-hydroxyphenyl)-1,1-dimethylurea | karbutilate | ✓ |
| K62.95-1971 | 2-chloro-4-(cyclopropylamino)-6-(isopropylamino)-s-triazine | cyprazine | ✓ |
| K62.96-1971 | 2,6-dinitro-N,N-dipropylcumidine | isopropalin | ✓ |
| K62.97-1970 | 5,6-dihydro-2-methyl-1,4-oxathiin-3-carboxanilide | carboxin | ✓ |
| K62.98-1971 | 5,6-dihydro-2-methyl-1,4-oxathiin-3-carboxanilide 4,4-dioxide | oxycarboxin | ✓ |
| K62.99-1971 | methyl sulfanilylcarbamate | asulam | ✓ |
| K62.100-1971 | α-(2,4-dichlorophenyl)-α-phenyl-5-pyrimidinemethanol | triarimol | ✓ |
| K62.101-1971 | tetrachloroisophthalonitrile | chlorothalonil | ✓ |
| K62.102-1971 | 3-(3,5-dichloropheny1)-5,5-dimethy1-2,4-oxazolidinedione | dichlozoline | ✓ |
| K62.103-1971 | O,O-diethyl O-(3,5,6-trichloro-2-pyridyl) phosphorothioate | chlorpyrifos | ✓ |
| K62.104-1971 | 2-(3,4-dichlorophenyl)-4-methyl-1,2,4-oxadiazolidine-3,5-dione | methazole | ✓ |
| K62.105-1971 | O-(4-bromo-2,5-dichlorophenyl) O-methyl phenylphosphonothioate | leptophos | ✓ |
| K62.106-1971 | 1-cyclohexene-1,2-dicarboximidomethyl 2,2-dimethyl-3-(2-methylpropenyl)cyclopropanecarboxylate | tetramethrin | ✓ |
| K62.107 | |||
| K62.108-1971 | 2-chloro-N-(ethoxymethyl)-6′-ethyl-o-acetotoluidide | acetochlor | ✓ |
| K62.109-1971 | α-cyclopropyl-α-(p-methoxphenyl)-5-pyrimidinemethanol | ancymidol | ✓ |
| K62.110.1972 | 4-tert-butyl-2-chlorophenyl methyl methylphosphoramidate | crufomate | ✓ |
| K62.111-1971 | dimethyl 3,5,6-trichloro-2-pyridyl phosphate | fospirate | ✓ |
| K62.112-1971 | methyl 3,6-dichloro-o-anisate | disugran | dicamba-methyl |
| K62.113-1972 | 3-(4-bromo-3-chlorophenyl)-1-methoxy-1-methylurea | chlorbromuron | ✓ |
| K62.114-1972 | N′-(4-chloro-o-tolyl)-N,N-dimethylformamidine | chlordimeform | ✓ |
| K62.115-1972 | p-nitrophenyl α,α,α-trifluoro-2-nitro-p-tolyl ether | fluorodifen | ✓ |
| K62.116-1972 | 2-chloro-N-(1-methyl-2-propynyl)acetanilide | prynachlor | ✓ |
| K62.117-1972 | N,N-bis(phosphonomethyl)glycine | glyphosine | ✓ |
| K62.118-1972 | 4-(dimethylamino)-3,5-xylyl methylcarbamate | mexacarbate | ✓ |
| K62.119-1972 | 2-sec-butyl-4,6-dinitrophenol | dinoseb | ✓ |
| K62.120-1972 | O,S-dimethyl acetylphosphoramidothioate | acephate | ✓ |
| K62.121-1975 | 3-(1-methylbutyl)phenyl methylcarbamate + 3-(1-ethylpropyl)phenyl methylcarbamate (3:1) | bufencarb | ✓ |
| K62.122 | |||
| K62.123-1972 | S-ethyl diethylthiocarbamate | ethiolate | ✓ |
| K62.124-1972 | N-(phosphonomethyl)glycine | glyphosate | ✓ |
| K62.125-1973 | 4-chloro-5-(methylamino)-2-(α,α,α-trifluoro-m-tolyl)-3(2H)-pyridazinone | norflurazon | ✓ |
| K62.126-1972 | methyl N′,N′-dimethyl-N-[((methylcarbamoyl) oxy]-1-thiooxamimidate | oxamyl | ✓ |
| K62.127-1972 | 4-amino-3,5,6-trichloropicolinic acid | picloram | ✓ |
| K62.128-1972 | 2-chloro-6-(trichloromethyl)pyridine | nitrapyrin | ✓ |
| K62.129-1972 | 3-isopropyl-1H-2,1,3-benzothiadiazin-4(3H)-one 2,2-dioxide | bentazon | bentazone |
| K62.130-1973 | O,O-dimethyl O-(3,5,6-trichloro-2-pyridyl) phosphorothioate | chlorpyrifos-methyl | ✓ |
| K62.131-1973 | 2-(p-tert-butylphenoxy)cyclohexyl 2-propynyl sulfite | propargite | ✓ |
| K62.132-1973 | isopropyl (E,E)-11-methoxy-3,7,11-trimethyl-2,4-dodecadienoate | methoprene | ✓ |
| K62.133-1973 | O-ethyl S,S-dipropyl phosphorodithioate | ethoprop | ethoprophos |
| K62.134-1973 | O,O-dimethyl phosphorodithioate S-ester with 4-(mercaptomethyl)-2-methoxy-1,3,4-thiadiazolin-5-one | methidathion | ✓ |
| K62.135-1973 | 2-(ethylthio)-4,6-bis(isopropylamino)-s-triazine | dipropetryn | ✓ |
| K62.136-1973 | ethyl (E,E)-3,7,11-trimethyl-2,4-dodecadienoate | hydroprene | ✓ |
| K62.137-1973 | 2-propynyl (E,E)-3,7,11-trimethyl-2,4-dodecadienoate | kinoprene | ✓ |
| K62.138-1973 | methyl 5-(2,4-dichlorophenoxy)-2-nitrobenzoate | bifenox | ✓ |
| K62.139-1973 | ethyl m-hydroxycarbanilate carbanilate (ester) | desmedipham | ✓ |
| K62.140-1973 | N-(2-chloroethyl)-α,α,α-trifluoro-2,6-dinitro-N-propyl-p-toluidine | fluchloralin | ✓ |
| K62.141-1973 | S-ethyl (E,E)-11-methoxy-3,7,11-trimethyl-2,4-dodecadienethioate | triprene | ✓ |
| K62.142-1973 | 2-(ethylamino)-4-(isopropylamino)-6-(methylthio)-s-triazine | ametryn | ✓ |
| K62.143-1973 | 2,4-bis(isopropylamino)-6-(methylthio)-s-triazine | prometryn | ✓ |
| K62.144-1973 | 2,4-bis(isopropylamino)-6-methoxy-s-triazine | prometon | ✓ |
| K62.145-1973 | 2-chloro-4,6-bis(isopropylamino)-s-triazine | propazine | ✓ |
| K62.146-1973 | cis-N-[(1,1,2,2-tetrachloroethyl)thio]-4-cyclohexene-1,2-dicarboximide | captafol | ✓ |
| K62.147-1973 | o-1,3-dioxolan-2-ylphenyl methylcarbamate | dioxacarb | ✓ |
| K62.148-1973 | 2-(tert-butylamino)-4-(ethylamino)-6-(methylthio)-s-triazine | terbutryn | ✓ |
| K62.149-1973 | 2-(tert-butylamino)-4-chloro-6-(ethylamino)-s-triazine | terbuthylazine | ✓ |
| K62.150-1973 | isopropyl 4,4′-dichlorobenzilate | chloropropylate | ✓ |
| K62.151-1973 | isopropyl 4,4′-dibromobenzilate | bromopropylate | ✓ |
| K62.152-1973 | N-(cyclopropylmethyl)-α,α,α-trifluoro-2,6-dinitro-N-propyl-p-toluidine | profluralin | ✓ |
| K62.153-1974 | 2-tert-butyl-4-(2,4-dichloro-5-isopropoxyphenyl)-1,3,4-oxadiazolin-5-one | oxadiazon | ✓ |
| K62.154-1974 | 4-(1,1-dimethylethyl)-N-(1-methylpropyl)-2,6-dinitrobenzenamine | butralin | ✓ |
| K62.155-1974 | 2-[[3,5 bis(1,1-dimethylethyl)-4-hydroxyphenyl]methylene] propanedinitrile | malonoben | ✓ |
| K62.156-1974 | 3,5-dimethyl-N-(1-methylethyl)-N-(phenylmethyl)benzamide | benzipram | ✓ |
| K62.157-1974 | N-[5-(2-chloro-1,1-dimethylethyl)-1,3,4-thiadiazol-2-yl]cyclopropanecarboxamide | cyprazole | ✓ |
| K62.158-1974 | N-[5-(1,1-dimethylethyl)-1,3,4-thiadiazol-2-yl]-N,N′-dimethylurea | tebuthiuron | ✓ |
| K62.159-1974 | 2,2-dimethyl-N-(1-methylethyl)-N-(phenylmethyl)propanamide | butam | tebutam |
| K62.160-1974 | 1-methyl-4-phenylpyridinium salts | cyperquat | ✓ |
| K62.161-1974 | dimethyl [(1,2-phenylene)bis(iminocarbonothioyl)]bis[carbamate] | thiophanate-methyl | ✓ |
| K62.162-1974 | 2-chloro-6-methoxy-4-(trichloromethyl)pyridine | pyroxychlor | ✓ |
| K62.163-1974 | O,O-diethyl (1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl) phosphonothioate | ditalimfos | ✓ |
| K62.164-1974 | 3,3-dimethyl-1-(methylthio)-2-butanone O-[(methylamino)carbonyl]oxime | thiofanox | ✓ |
| K62.165-1974 | N-[4-methyl-3-[[(trifluoromethyl)sulfonyl]amino] phenyl]acetamide | fluoridamid | ✓ |
| K62.166-1974 | 1,1,1-trifluoro-N-[2-methyl-4-(phenylsulfonyl)phenyl]methanesulfonamide | perfluidone | ✓ |
| K62.167-1974 | cis-2,5-dimethyl-N-phenyl-1-pyrrolidinecarboxamide | cisanilide | none |
| K62.168-1974 | 2-[[4-chloro-6-(cyclopropylamino)-1,3,5-triazin-2-yl]amino]-2-methylpropanenitrile | procyazine | ✓ |
| K62.169-1974 | N,N′-[1,4-piperazinediylbis(2,2,2-trichloroethylidene)]bis[formamide] | triforine | ✓ |
| K62.170-1974 | butanedioic acid mono(2,2-dimethylhydrazide) | daminozide | ✓ |
| K62.171-1975 | [(3,5,6-trichloro-2-pyridinyl)oxy]acetic acid | triclopyr | ✓ |
| K62.172-1974 | 1,2-dimethyl-3,5-diphenyl-1H-pyrazolium salts | difenzoquat | ✓ |
| K62.173-1974 | O-(2,4-dichlorophenyl) O,O-diethyl phosphorothioate | dichlofenthion | ✓ |
| K62.174-1974 | S-[[(1,1-dimethylethyl)thio]methyl] O,O-diethyl phosphorodithioate | terbufos | ✓ |
| K62.175-1977 | N-(1-ethylpropyl)-3,4-dimethyl-2,6-dinitrobenzenamine | pendimethalin | ✓ |
| K62.176-1974 | N-ethyl N-(2-methyl-2-propenyl)-2,6-dinitro-4-(trifluoromethyl)benzenamine | ethalfluralin | ✓ |
| K62.177-1974 | 5-methyl-1,2,4-triazolo[3,4-b]benzothiazole | tricyclazole | ✓ |
| K62.178-1975 | N-[[4-(dipropylamino)-3,5-dinitrophenyl]sulfonyl]-S,S-dimethylsulfilimine | prosulfalin | ✓ |
| K62.179-1974 | α-(4-chlorophenyl)-α-(1-methylethyl)-5-pyrimidinemethanol | isopyrimol | ✓ |
| K62.180-1975 | O,O′-(thiodi-4,1-phenylene) bis(O,O-dimethyl phosphorothioate) | temephos | ✓ |
| K62.181-1975 | N-ethyl-6-methoxy-N′-(1-methylpropyl)-1,3,5-triazine-2,4-diamine | secbumeton | ✓ |
| K62.182-1976 | N-[2,4-dimethyl-5-[[(trifluoromethyl)sulfonyl]amino]phenyl]acetamide | mefluidide | ✓ |
| K62.183-1976 | N-(butoxymethyl)-2-chloro-N-[2-(1,1-dimethylethyl)-6-methylphenyl]acetamide | terbuchlor | ✓ |
| K62.184-1975 | tricyclohexylhydroxystannane | cyhexatin | ✓ |
| K62.185-1976 | α-(2-chlorophenyl)-α-(4-chlorophenyl)-5-pyrimidinementhanol | fenarimol | ✓ |
| K62.186-1977 | phenyl N,N′-dimethylphosphorodiamidate | diamidafos | ✓ |
| K62.187-1977 | S-[(4-chlorophenyl)methyl] diethylcarbamothioate | thiobencarb | ✓ |
| K62.188-1976 | N,N-dimethyl-N′-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]urea | tetrafluron | ✓ |
| K62.189-1976 | N3,N3-diethyl-2,4-dinitro-6-(trifluoromethyl)-1,3-benzenediamine | dinitramine | ✓ |
| K62.190-1977 | 2,4-dinitro-N3,N3-dipropyl-6-(trifluoromethyl)-1,3-benzenediamine | prodiamine | ✓ |
| K62.191-1976 | 3-[5-(1,1-dimethylethyl)-1,3,4-thiadiazol-2-yl]-4-hydroxy-1-methyl-2-imidazolidinone | buthidazole | ✓ |
| K62.192-1976 | α-(2-chlorophenyl)-α-(4-fluorophenyl)-5-pyrimidinemethanol | nuarimol | ✓ |
| K62.193-1976 | 1-methyl-3-phenyl-5-[3-(trifluoromethyl)phenyl]-4(1H)-pyridinone | fluridone | ✓ |
| K62.194-1977 | methyl [[[2-[(2-furanylmethylene)amino]phenyl]amino]thioxomethyl]carbamate | furophanate | ✓ |
| K62.195-1977 | 4-butyl-4H-1,2,4-triazole | triazbutil | ✓ |
| K62.196-1977 | 2-chloro-1-(4-nitrophenoxy)-4-(trifluoromethyl)benzene | nitrofluorfen | ✓ |
| K62.197-1977 | 2-chloro-1-(3-ethoxy-4-nitrophenoxy)-4-(trifluoromethyl)benzene | oxyfluorfen | ✓ |
| K62.198-1976 | 2-chloro-N-(2-ethyl-6-methylphenyl)-N-(2-methoxy-1-methylethyl)acetamide | metolachlor | ✓ |
| K62.199-1977 | O-(6-ethoxy-2-ethyl-4-pyrimidinyl) O,O-dimethyl phosphorothioate | etrimfos | ✓ |
| K62.200-1977 | N-phenyl-N′-1,2,3-thiadiazol-5-ylurea | thidiazuron | ✓ |
| K62.201-1977 | N-[(4-chlorophenyl)amino]carbonyl]-2,6-difluorobenzamide | diflubenzuron | ✓ |
| K62.202-1977 | O,S-dimethyl phosphoramidothioate | methamidophos | ✓ |
| K62.203-1977 | N′-(2,4-dimethylphenyl)-N-[[(2,4-dimethylphenyl)imino]methyl]-N-methylmethanimidamide | amitraz | ✓ |
| K62.204-1977 | 4,4-dimethyl-5-[[[(methylamino)carbonyl]oxy]imino]pentanenitrile | nitrilacarb | ✓ |
| K62.205-1977 | 2-(4-(2,4-dichlorophenoxy)phenoxy)propanoic acid | diclofop | ✓ |
| K62.206-1978 | ethyl hydrogen (aminocarbonyl)phosphonate | fosamine | ✓ |
| K62.207-1977 | O-ethyl S-propyl O-(2,4,6-trichlorophenyl) phosphorothioate | trifenofos | ✓ |
| K62.208-1977 | N-(2-methyl-2-propenyl)-2,6-dinitro-N-propyl-4-(trifluoroethyl)benzenamine | methalpropalin | ✓ |
| K62.209-1978 | 2-methyl-2-(methylsulfonyl)propanal O-[(methylamino)carbonyl)]oxime | aldoxycarb | ✓ |
| K62.210-1977 | 2-(dimethylamino)-5,6-dimethyl-4-pyrimidinyl dimethylcarbamate | pirimicarb | ✓ |
| K62.211-1977 | O-[2-(diethylamino)-6-methyl-4-pyrimidinyl] O,O-diethyl phosphorothioate | pirimiphos-ethyl | ✓ |
| K62.212 | |||
| K62.213-1977 | 5-butyl-2-(ethylamino)-6-methyl-4-pyrimidinyl dimethylsulfamate | bupirimate | ✓ |
| K62.214-1978 | (phenylimino)di-2,1-ethanediyl bis(3,6-dichloro-2-methoxybenzoate) | cambendichlor | ✓ |
| K62.215-1978 | 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoic acid | acifluorfen | ✓ |
| K62.216-1977 | O-[2-(diethylamino)-6-methyl-4-pyrimidinyl] O,O-dimethyl phosphorothioate | pirimiphos-methyl | ✓ |
| K62.217-1977 | (3-phenoxyphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylate | permethrin | ✓ |
| K62.218-1978 | N-(chloroacetyl)-N-(2,6-diethylphenyl)glycine | diethatyl | ✓ |
| K62.219-1978 | O-[2,5-dichloro-4-(methylthio)phenyl] O,O-diethyl phosphorothioate and the 2,4,5 and 4,5,2 isomers (73:14:13) | chlorthiophos | ✓ |
| K62.220-1979 | dimethyl N,N′-[thiobis[(methylimino)carbonyloxy]] bis[ethanimidothioate] | thiodicarb | ✓ |
| K62.221-1978 | 3-cyclohexyl-6-(dimethylamino)-1-methyl-1,3,5-triazine-2,4(1H,3H)-dione | hexazinone | ✓ |
| K62.222-1979 | 2-octyl-3(2H)-isothiazolone | octhilinone | ✓ |
| K62.223-1978 | (±)-2-ethoxy-2,3-dihydro-3,3-dimethyl-5-benzofuranyl methanesulfonate | ethofumesate | ✓ |
| K62.224-1978 | O-(4-bromo-2-chlorophenyl) O-ethyl S-propyl phosphorothioate | profenofos | ✓ |
| K62.225-1978 | N-(4-nitrophenyl)-N′-(3-pyridinylmethyl)urea | pyrinuron | ✓ |
| K62.226-1979 | diethyl 1,3-dithietan-2-ylidenephosphoramidate | fosthietan | ✓ |
| K62.227-1979 | α-butyl-α-phenyl-1H-imidazole-1-propanenitrile | fenapanil | ✓ |
| K62.228-1979 | 2,4,5-trimethyl-N-phenyl-3-furancarboxamide | methfuroxam | ✓ |
| K62.229 | |||
| K62.230 | |||
| K62.231-1978 | 2,2-dimethyl-1,3-benzodioxol 4-yl methylcarbamate | bendiocarb | ✓ |
| K62.232-1978 | [5-(phenylmethyl)-3-furanyl]methyl 2,2-dimethyl-3-(2-methyl-1-propenyl)cyclopropanecarboxylate | resmethrin | ✓ |
| K62.233-1978 | (E)-1-methylethyl 3-[[(ethylamino)methoxyphosphinothioyl]oxy]-2-butenoate | propetamphos | ✓ |
| K62.234-1979 | 3-[3-(4′-bromo[1,1′-biphenyl]-4-yl)-1,2,3,4-tetrahydro-1-naphthalenyl]-4-hydroxy-2H-1-benzopyran-2-one | brodifacoum | ✓ |
| K62.235-1979 | N-(2,6-dimethylphenyl)-N-(methoxyacetyl)-DL-alanine methyl ester | metalaxyl | ✓ |
| K62.236-1981 | 2-chloro-N-(2,6-dimethylphenyl)-N-(tetrahydro-2-oxo-3-furanyl)acetamide | ofurace | ✓ |
| K62.237-1979 | propyl [3-(dimethylamino)propyl]carbamate | propamocarb | ✓ |
| K62.238 | |||
| K62.239-1979 | 2,3:4,6-bis-O-(1-methylethylidene)-α-L-xylo-2-hexulofuranosonic acid | dikegulac | ✓ |
| K62.240 | |||
| K62.241-1980 | (E)-(±)-4-[4-[4-(trifluoromethyl)phenoxy]phenoxy]-2-pentenoic acid | difenopenten | ✓ |
| K62.242-1980 | 2-cyano-N-[(ethylamino)carbonyl]-2-(methoxyimino)acetamide | cymoxanil | ✓ |
| K62.243-1980 | N-methyl-2,4-dinitro-N-(2,4,6-tribromophenyl)-6-(trifluoromethyl)benzenamine | bromethalin | ✓ |
| K62.244-1980 | N-propyl-N-[2-(2,4,6,-trichlorophenoxy)ethyl]-1H-imidazole-1-carboxamide | prochloraz | ✓ |
| K62.245-1980 | cyano(3-phenoxyphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylate | cypermethrin | ✓ |
| K62.246-1980 | 1-[2-(2,4-dichlorophenyl)-2-(2-propenyloxy)ethyl]-1H-imidazole | imazalil | ✓ |
| K62.247-1981 | N′-[5-(1,1-dimethylethyl)-3-isoxazolyl]-N,N-dimethylurea | isouron | ✓ |
| K62.248-1981 | 2,3-dihydro-2,2-dimethyl-7-benzofuranyl [(dibutylamino)thio]methylcarbamate | carbosulfan | ✓ |
| K62.249-1981 | 2-chloro-N-[[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)amino]carbonyl]benzenesulfonamide | chlorsulfuron | ✓ |
| K62.250-1981 | 1-(4-chlorophenyl)-1,4-dihydro-6-methyl-4-oxo-3-pyridazinecarboxylic acid | fenridazon | ✓ |
| K62.251-1982 | cyano(3-phenoxyphenyl)methyl 4-(difluoromethoxy)-α-(1-methylethyl)benzeneacetate | flucythrinate | ✓ |
| K62.252-1981 | N-cyclopropyl-1,3,5-triazine-2,4,6-triamine | cyromazine | ✓ |
| K62.253-1981 | O,O-diethyl O-[6-methyl-2-(1-methylethyl)-4-pyrimidinyl] phosphorothioate | diazinon | ✓ |
| K62.254-1983 | cyano(6-phenoxy-2-pyridinyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropancarboxylate | fenpirithrin | ✓ |
| K62.255-1982 | 2-chloro-6-(2-furanylmethoxy)-4-(trichloromethyl)pyridine | pyroxyfur | ✓ |
| K62.256-1982 | N-[4-(ethylthio)-2-(trifluoromethyl)phenyl]methanesulfonamide | benzofluor | ✓ |
| K62.257-1982 | 3-(3,5-dichlorophenyl)-N-(1-methylethyl)-2,4-dioxo-1-imidazolidinecarboxamide | iprodione | ✓ |
| K62.258-1982 | N-[2-chloro-4-(trifluoromethyl)phenyl]-DL-valine (±)-cyano(3-phenoxyphenyl)methyl ester | fluvalinate | ✓ |
| K62.259-1982 | 2,3-dihydro-5,6-dimethyl-1,4-dithiin 1,1,4,4-tetraoxide | dimethipin | ✓ |
| K62.260-1982 | α-(1-methylethyl)-α-[4-(trifluoromethoxy)phenyl]-5-pyrimidinemethanol | flurprimidol | ✓ |
| K62.261-1982 | (±)-2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoic acid | fluazifop | ✓ |
| K62.262-1984 | 5-(4-chlorophenyl)-2,3-diphenylthiophene | triarathene | ✓ |
| K62.263-1983 | N-[2-amino-3-nitro-5-(trifluoromethyl)phenyl]-2,2,3,3-tetrafluoropropanamide | nifluridide | ✓ |
| K62.264 | |||
| K62.265-1983 | 2-[[[[(4,6-dimethyl-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]benzoic acid, | sulfometuron | ✓ |
| K62.266-1985 | N-[3-(1-ethyl-1-methylpropyl)-5-isoxazoyl]-2,6-dimethoxybenzamide | isoxaben | ✓ |
| K62.267 | |||
| K62.268-1983 | 2-(3,5-dichlorophenyl)-2-(2,2,2-trichloroethyl)oxirane | tridiphane | ✓ |
| K62.269-1983 | 5-[2-chloro-4-(trifluoromethyl)phenoxy]-N-(methylsulfonyl)-2-nitrobenzamide | fomesafen | ✓ |
| K62.270-1985 | tetrahydro-5,5-dimethyl-2(1H)-pyrimidinone [3-[4-(trifluoromethyl)phenyl]-1-[2-[4-(trifluoromethyl)phenyl]ethenyl-2-propenylidene]hydrazone | hydramethylnon | ✓ |
| K62.271-1983 | 4-chloro-2-oxo-3(2H)-benzothiazoleacetic acid | benazolin | ✓ |
| K62.272-1983 | 2-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoic acid | haloxyfop | ✓ |
| K62.273-1984 | 3,6-dichloro-2-pyridinecarboxylic acid | clopyralid | ✓ |
| K62.274 | |||
| K62.275-1984 | (±)-2-ethoxy-1-methyl-2-oxoethyl 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2 nitrobenzoate | lactofen | none |
| K62.276-1983 | 3,4,5-trimethylphenyl methylcarbamate, mixture with 2,3,5-trimethylphenyl methylcarbamate (approximately 4:1) | trimethacarb | ✓ |
| K62.277-1985 | (E,E)-(±)-2-[1-[[(3-chloro-2-propenyl)oxy]imino]butyl]-5-[2-(ethylthio)propyl]-3-hydroxy-2-cyclohexen-1-one | cloproxydim | ✓ |
| K62.278-1983 | 2-[[[[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)amino]carbonyl]amino]sulfonyl]benzoic acid | metsulfuron | ✓ |
| K62.279-1985 | ethyl [2-(4-phenoxyphenoxy)ethyl]carbamate | fenoxycarb | ✓ |
| K62.280-1984 | 2-(4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]-3-quinolinecarboxylic acid | imazaquin | ✓ |
| K62.281-1986 | (±)-2-[4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]-3-pyridinecarboxylic acid | imazapyr | ✓ |
| K62.282-1985 | exo-1-methyl-4-(1-methylethyl)-2-[(2-methylphenyl)methoxy]-7-oxabicyclo[2.2.1]heptane | cinmethylin | ✓ |
| K62.283-1988 | 2,4-dimethyl-N-phenyl-5-thiazolecarboxamide | metsulfovax | ✓ |
| K62.284-1991 | (±)-2-[4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]-4(and 5)-methylbenzoic acid (3:2) | imazamethabenz | ✓ |
| K62.285-1984 | (±)-N-(3-chlorophenyl)-N-(tetrahydro-2-oxo-3-furanyl)cyclopropanecarboxamide | cyprofuram | ✓ |
| K62.286-1986 | carboxymethyl 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate | fluoroglycofen | ✓ |
| K62.287-1985 | (±)-2-[4-[(6-chloro-2-benzoxazolyl)oxy]phenoxy]propanoic acid | fenoxaprop | ✓ |
| K62.288-1985 | 5-O-demethylavermectin A1a + 5-O-demethyl-25-de(1-methylpropyl)-25-(1-methylethyl)avermectin A1a (4:1) | abamectin | ✓ |
| K62.289-1985 | β-[(4-chlorophenyl)methyl]-α-(1,1-dimethylethyl)-1H-1,2,4-triazole-1-ethanol | paclobutrazol | ✓ |
| K62.290-1986 | 3,6-bis(2-chlorophenyl)-1,2,4,5-tetrazine | clofentezine | ✓ |
| K62.291-1986 | (R)-2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoic acid | fluazifop-P | ✓ |
| K62.292-1986 | [1α,3α(Z)]-(±)-(2-methyl[1,1′-biphenyl]-3-yl)methyl 3-(2-chloro-3,3,3-trifluoro-1-propenyl)-2,2-dimethylcyclopropanecarboxylate | bifenthrin | ✓ |
| K62.293-1986 | α-butyl-α-(4-chlorophenyl)-1H-1,2,4-triazole-1-propanenitrile | myclobutanil | ✓ |
| K62.294-1986 | 2-[4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]-5-ethyl-3-pyridinecarboxylic acid | imazethapyr | ✓ |
| K62.295-1986 | 2-[[[[(4-chloro-6-methoxy-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]benzoic acid | chlorimuron | ✓ |
| K62.296-1990 | N-acetylaminomethyl-2-chloro-N-2,6-diethylphenylacetamide | amidochlor | none |
| K62.297-1988 | 2-[[[[[(4,6-dimethoxy-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]methyl]benzoic acid | bensulfuron | ✓ |
| K62.298-1986 | (±)-2-[4-[(6-chloro-2-quinoxalinyl)oxy]phenoxy]propanoic acid | quizalofop | ✓ |
| K62.299-1986 | 1-[[2-(2,4-dichlorophenyl)-1,3-dioxolan-2-yl]methyl]-1H-1,2,4-triazole | azaconazole | ✓ |
| K62.300-1989 | 2-[(2-chlorophenyl)methyl]-4,4-dimethyl-3-isoxazolidinone | clomazone | ✓ |
| K62.301-1988 | 1-(2,4-dichlorophenyl)-2-(3-pyridinyl)ethanone O-methyloxime | pyrifenox | ✓ |
| K62.302-1989 | O-ethyl S,S-bis(1-methylpropyl) phosphorodithioate | cadusafos | ✓ |
| K62.303-1989 | N-(2-chloro-4-pyridinyl)-N′-phenylurea | forchlorfenuron | ✓ |
| K62.304-1990 | 1-[[bis(4-fluorophenyl)methylsilyl]methyl]-1H-1,2,4-triazole | flusilazole | ✓ |
| K62.305-1988 | O-[5-chloro-1-(1-methylethyl)-1H-1,2,4-triazol-3-yl] O,O-diethyl phosphorothioate | isazofos | ✓ |
| K62.306-1990 | 3-[[[[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)amino]carbonyl]amino]sulfonyl]-2-thiophenecarboxylic acid | thifensulfuron | ✓ |
| K62.307-1989 | (E,E)-(±)-2-[1-[[(3-chloro-2-propenyl)oxy]imino]propyl]-5-[2-(ethylthio)propyl]-3-hydroxy-2-cyclohexen-1-one | clethodim | ✓ |
| K62.308 | |||
| K62.309-1990 | (±)-α-butyl-α-(2,4-dichlorophenyl)-1H-1,2,4-triazole-1-ethanol | hexaconazole | ✓ |
| K62.310-1988 | (E)-(±)-β-[(2,4-dichlorophenyl)methylene]-α-(1,1-dimethylethyl)-1H-1,2,4-triazole-1-ethanol | diniconazole | ✓ |
| K62.311-1988 | (E)-(±)-β-[(4-chlorophenyl)methylene]-α-(1,1-dimethylethyl)-1H-1,2,4-triazole-1-ethanol | uniconazole | ✓ |
| K62.312-1990 | (±)-5-(methylamino)-2-phenyl-4-[3-(trifluoromethyl)phenyl]-3(2H)-furanone | flurtamone | ✓ |
| K62.313-1990 | [1α,3α(Z)]-(±)-(2,3,5,6-tetrafluoro-4-methylphenyl)methyl 3-(2-chloro-3,3,3-trifluoro-1-propenyl)-2,2-dimethylcyclopropanecarboxylate | tefluthrin | ✓ |
| K62.314-1990 | α-(2-fluorophenyl)-α-(4-fluorophenyl)-1H-1,2,4-triazole-1-ethanol | flutriafol | ✓ |
| K62.315-1990 | 5-[2-chloro-6-fluoro-4-(trifluoromethyl)phenoxy]-N-(ethylsulfonyl)-2-nitrobenzamide | halosafen | ✓ |
| K62.316-1990 | N-[[[3,5-dichloro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]amino]carbonyl]-2,6-difluorobenzamide | hexaflumuron | ✓ |
| K62.317-1989 | S,S-dimethyl 2-(difluoromethyl)-4-(2-methylpropyl)-6-(trifluoromethyl)-3,5-pyridinedicarbothioate | dithiopyr | ✓ |
| K62.318 | |||
| K62.319-1990 | cyano(3-phenoxyphenyl)methyl 2,2-dimethyl-3-(1,2,2,2-tetrabromoethyl)cyclopropanecarboxylate | tralomethrin | ✓ |
| K62.320 | |||
| K62.321-1990 | O-[2-(1,1-dimethylethyl)-5-pyrimidinyl] O,O-diethyl phosphorothioate | butathiofos | ✓ |
| K62.322-1990 | N-ethyl-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-1-octanesulfonamide | sulfluramid | ✓ |
| K62.323-1990 | 2-[[[[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)methylamino]carbonyl]amino]sulfonyl]benzoic acid | tribenuron | ✓ |
| K62.324 | |||
| K62.325 | |||
| K62.326 | |||
| K62.327-1991 | 4-[2-[4-(1,1-dimethylethyl)phenyl]ethoxy]quinazoline | fenazaquin | ✓ |
| K62.328-1990 | cyano(3-phenoxyphenyl)methyl 2,2,3,3-tetramethylcyclopropanecarboxylate | fenpropathrin | ✓ |
| K62.329-1991 | 2-[[[[(4,6-dimethoxy-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]-N,N-dimethyl-3-pyridinecarboxamide | nicosulfuron | ✓ |
| K62.330-1992 | N-[[(4,6-dimethoxy-2-pyrimidinyl)amino]carbonyl]-3-(ethylsulfonyl)-2-pyridinesulfonamide | rimsulfuron | ✓ |
| K62.331-1992 | 2-[[[[[4-ethoxy-6-(methylamino)-1,3,5-triazin-2-yl]amino]carbonyl]amino]sulfonyl]benzoic acid | ethametsulfuron | ✓ |
| K62.332-1992 | O,O-diethyl O-(1,2,2,2-tetrachloroethyl) phosphorothioate | chlorethoxyfos | ✓ |
| K62.333-1992 | α-[2-(4-chlorophenyl)ethyl]-α-phenyl-1H-1,2,4-triazole-1-propanenitrile | fenbuconazole | ✓ |
| K62.334-1991 | 2-amino-4-(hydroxymethylphosphinyl)butanoic acid | glufosinate | ✓ |
| K62.335-1992 | 2-(2-ethoxyethoxy)ethyl 1H-benzimidazol-2-ylcarbamate | debacarb | ✓ |
| K62.336-1993 | cyano(3-phenoxyphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylate | zeta-cypermethrin | ✓ |
| K62.337-1993 | N-(2,6-difluorophenyl)-5-methyl[1,2,4]triazolo[1,5-a]pyrimidine-2-sulfonamide | flumetsulam | ✓ |
| K62.338-1993 | (4″R)-5-O-demethyl-4″-deoxy-4″-(methylamino)avermectin A1a + (4″R)-5-O-demethyl-25-de(1-methylpropyl)-4″-deoxy-4″-(methylamino)-25-(1-methylethyl)avermectin | emamectin | ✓ |
| K62.339-1993 | 3,5-dimethylbenzoic acid 1-(1,1-dimethylethyl)-2-(4-ethylbenzoyl)hydrazide | tebufenozide | ✓ |
| K62.340-1993 | N-[2,6-dibromo-4-(trifluoromethoxy)phenyl]-2-methyl-4-(trifluoromethyl)-5-thiazolecarboxamide | thifluzamide | ✓ |
| K62.341-1993 | 2-[[[[[4-(dimethylamino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]carbonyl]amino]sulfonyl]-3-methylbenzoic acid | triflusulfuron | ✓ |
| K62.342-1993 | methyl 2-(difluoromethyl)-5-(4,5-dihydro-2-thiazolyl)-4-(2-methylpropyl)-6-(trifluoromethyl)-3-pyridinecarboxylate | thiazopyr | ✓ |
| K62.343-1995 | 1-methylethyl 2-chloro-5-[3,6-dihydro-3-methyl-2,6-dioxo-4-(trifluoromethyl)-1(2H)-pyrimidinyl]benzoate | flupropacil | ✓ |
| K62.344-1993 | tetrahydro-2-(nitromethylene)-2H-1,3-thiazine | nithiazine | ✓ |
| K62.345-1993 | N-[2,4-dichloro-5-[4-(difluoromethyl)-4,5-dihydro-3-methyl-5-oxo-1H-1,2,4-triazol-1-yl]phenyl]methanesulfonamide | sulfentrazone | ✓ |
| K62.346-1993 | N-(2,6-dichloro-3-methylphenyl)-5,7-dimethoxy[1,2,4]triazolo[1,5-a]pyrimidine-2-sulfonamide | metosulam | ✓ |
| K62.347 | |||
| K62.348-1995 | N-[[(4,6-dimethoxy-2-pyrimidinyl)amino]carbonyl]-1-methyl-4-(2-methyl-2H-tetrazol-5-yl)-1H-pyrazole-5-sulfonamide | azimsulfuron | ✓ |
| K62.349-1995 | 2-(4-chlorophenyl)-3-ethyl-2,5-dihydro-5-oxo-4-pyridazinecarboxylic acid | clofencet | ✓ |
| K62.350-1994 | 2-chloro-4-fluoro-5-(1,3,4,5,6,7-hexahydro-1,3-dioxo-2H-isoindol-2-yl)phenoxyacetic acid | flumiclorac | ✓ |
| K62.351-1997 | 4-bromo-2-(4-chlorophenyl)-1-(ethoxymethyl)-5-(trifluoromethyl)-1H-pyrrole-3-carbonitrile | chlorfenapyr | ✓ |
| K62.352-1994 | 2-chloro-6-(4,6-dimethoxy-2-pyrimidinyl)thiobenzoic acid | pyrithiobac | ✓ |
| K62.353-1995 | N-2-(cyclopropylcarbonyl)phenylaminosulfonyl-N′-(4,6-dimethoxy-2-pyrimidinyl)urea | cyclosulfamuron | ✓ |
| K62.354-1995 | (R)-2-[4-(4-cyano-2-fluorophenoxy)phenoxy]propanoic acid | cyhalofop | ✓ |
| K62.355-1997 | 2-[[[[(4,6-dimethoxy-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]-6-(trifluoromethyl)-3-pyridinecarboxylic acid | flupyrsulfuron | ✓ |
| K62.356-1997 | α,2-dichloro-5-[4-(difluoromethyl)-4,5-dihydro-3-methyl-5-oxo-1H-1,2,4-triazol-1-yl]-4-fluorobenzenepropanoic acid | carfentrazone | ✓ |
| K62.357-1994 | 2-[7-fluoro-3,4-dihydro-3-oxo-4-(2-propyn-1-yl)-2H-1,4-benzoxazin-6-yl]-4,5,6,7-tetrahydro-1H-isoindole-1,3(2H)-dione | flumioxazin | ✓ |
| K62.358-1997 | 2-(4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl)-5-(methoxymethyl)-3-pyridinecarboxylic acid | imazamox | ✓ |
| K62.359-1997 | 5-[[2-amino-5-O-(aminocarbonyl)-2-deoxy-L-xylonoyl]amino]-1-(5-carboxy-3,4-dihydro-2,4-dioxo-1(2H)-pyrimidinyl)-1,5-dideoxy-β-D-allofuranuronic acid | polyoxorim | ✓ |
| K62.360-1997 | 5-methyl-5-(4-phenoxyphenyl)-3-(phenylamino)-2,4-oxazolidinedione | famoxadone | ✓ |
| K62.361-1997 | 2-[2,4-dichloro-5-(2-propynyloxy)phenyl]-5,6,7,8-tetrahydro-1,2,4-triazolo[4,3-a]pyridin-3(2H)-one | azafenidin | ✓ |
| K62.362-1997 | [2R-[2R*,3aS*,5aR,5bS*,9S*,13S*(2R*,5S*,6R*),14R*,16aS*,16bR*]]-2-[(6-deoxy-2,3,4-tri-O-methyl-α-L-mannopyranosyl)oxy]-13-[[5-(dimethylamino)tetrahydro-6-methyl-2 | spinosad | ✓ |
| K62.363 | |||
| K62.364-1997 | 4-chlorobenzoic acid 2-benzoyl-2-(1,1-dimethylethyl)hydrazide | halofenozide | ✓ |
| K62.365-1998 | (S)-methyl 7-chloro-2,5-dihydro-2-[[(methoxycarbonyl)[4-(trifluoromethoxy)phenyl]amino]carbonyl]indeno[1,2-e][1,3,4]oxadiazine-4a(3H)-carboxylate | indoxacarb | ✓ |
| K62.366-1997 | 5,7-dichloro-4-(4-fluorophenoxy)quinoline | quinoxyfen | ✓ |
| K62.367-1997 | 3-chloro-2-[[(5-ethoxy-7-fluoro[1,2,4]triazolo[1,5-c]pyrimidin-2-yl)sulfonyl]amino]benzoic acid | cloransulam | ✓ |
| K62.368-1997 | N-(2,6-dichlorophenyl)-5-ethoxy-7-fluoro[1,2,4]triazolo[1,5-c]pyrimidine-2-sulfonamide | diclosulam | ✓ |
| K62.369-1997 | [(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetic acid | fluroxypyr | ✓ |
| K62.370-1997 | 1-methylethyl 2-(4-methoxy[1,1′-biphenyl]-3-yl)hydrazinecarboxylate | bifenazate | ✓ |
| K62.371-1998 | methoxyfenozide | ✓ | |
| K62.372 | flupyrazofos | none |
Alan Wood – 30th August 2025