The K62 committee was established in 1954 by the American Standards Association (ASA), which became the USA Standards Institute and then the American National Standards Institute (ANSI). Prior to this, common names were established by the Interdepartmental Committee on Pest Control.
The common names were published as separate standards that were withdrawn after five or 10 years, unless they were reaffirmed or revised.
The K62 committee was disbanded in 1997, and by the end of 2008 all of its standards had been withdrawn.
ANSI and its predecessors did not publish a complete list of K62 common names. The following table was compiled from several documents found on the Internet in 2025. A table of numbers for which no information could be found is at the end of this document.
A few ANSI names were not ISO names and did not have ISO equivalents: amidochlor, cisanilide, dicapthon, ethephon, flupyrazofos, lactofen, parinol, swep and zoalene (a coccidiostat). The eight relevant names have been adopted for inclusion in ISO 1750 and will be included in the March 2026 update of the XML data set for ISO 1750:2023 (Pesticides and other agrochemicals — Common names).
The columns in the table can be sorted by clicking any of the headings. Clicking again will reverse the sorting order.
| Number | ANSI name | ISO name | Systematic name in title of standard |
|---|---|---|---|
| K62.1-1956 | Procedure for the Acceptance of an American Standard Common Name for a Pest Control Chemical | ||
| K62.2-1957 | monuron | = | 3-(p-chlorophenyl)-1,1-dimethylurea |
| K62.3-1957 | diuron | = | 3-(3,4-dichlorophenyl)-1,1-dimethylurea |
| K62.6-1957 | erbon | = | 2-(2,4,5-trichlorophenoxy)ethyl 2,2-dichloropropionate |
| K62.7-1958 | fenuron | = | 3-phenyl-1,1-dimethylurea |
| K62.8-1957 | neburon | = | 1-butyl-3-(3,4-dichlorophenyl)-1-methylurea |
| K62.9-1957 | dalapon | = | 2,2-dichloropropionic acid |
| K62.10-1957 | silvex | fenoprop | 2-(2,4,5-trichlorophenoxy)propionic acid |
| K62.11-1957 | ovex | chlorfenson | p-chlorophenyl p-chlorobenzenesulfonate |
| K62.12-1958 | ethion | = | O,O,O′,O′-tetraethyl S,S′-methylene bisphosphorodithioate |
| K62.13-1958 | diphacinone | = | 2-diphenylacetyl-1,3-indandione |
| K62.14-1958 | dicapthon | = | O-(2-chloro-4-nitrophenyl) O,O-dimethyl phosphorothioate |
| K62.15-1958 | phosphamidon | = | 2-chloro-2-diethylcarbamoyl-1-methylvinyl dimethyl phosphate |
| K62.16-1958 | dimethoate | = | O,O-dimethyl S-(N-methylcarbamoylmethyl) phosphorodithioate |
| K62.18-1958 | ronnel | fenchlorphos | O,O-dimethyl O-2,4,5-trichlorophenyl phosphorothioate |
| K62.19-1959 | zoalene | n/a | 3,5-dinitro-o-toluamide |
| K62.20-1959 | chlorbenside | = | p-chlorobenzyl p-chlorophenyl sulfide |
| K62.21-1959 | dodine | = | N-dodecylguanidine acetate |
| K62.22-1959 | phorate | = | O,O-diethyl S-(ethylthio)methyl phosphorodithioate |
| K62.23-1960 | barban | = | 4-chloro-2-butynyl m-chlorocarbanilate |
| K62.24-1961 | amitrole | = | 3-amino-s-triazole |
| K62.25-1961 | folpet | = | N-(trichloromethylthio)phthalimide |
| K62.26-1961 | atrazine | = | 2-chloro-4-ethylamino-6-isopropylamino-s-triazine |
| K62.27-1961 | chlorazine | = | 2-chloro-4,6-bis(diethylamino)-s-triazine |
| K62.28-1961 | simazine | = | 2-chloro-4,6-bis(ethylamino)-s-triazine |
| K62.29-1961 | trietazine | = | 2-chloro-4-diethylamino-6-ethylamino-s-triazine |
| K62.30-1962 | endosulfan | = | 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-6,9-methano-2,4,3-benzodioxathiepin 3-oxide |
| K62.31-1961 | tetradifon | = | 4-chlorophenyl 2,4,5-trichlorophenyl sulfone |
| K62.32-1962 | dimethrin | = | 2,4-dimethylbenzyl 2,2-dimethyl-3-(2-methylpropenyl)cyclopropanecarboxylate |
| K62.33-1962 | carbophenothion | = | S-[(p-chlorophenylthio)methyl] O,O-diethyl phosphorodithioate |
| K62.34-1962 | linuron | = | 3-(3,4-dichlorophenyl)-1-methoxy-1-methylurea |
| K62.35-1962 | naled | = | 1,2-dibromo-2,2-dichloroethyl dimethyl phosphate |
| K62.36-1962 | endothall | endothal | 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid |
| K62.37-1962 | amiben | chloramben | 3-amino-2,5-dichlorobenzoic acid |
| K62.38-1962 | carbaryl | = | 1-naphthyl methylcarbamate |
| K62.39-1962 | isocil | = | 5-bromo-3-isopropyl-6-methyluracil |
| K62.40-1962 | binapacryl | = | 2-sec-butyl-4,6-dinitrophenyl 3-methyl-2-butenoate |
| K62.41-1962 | endothion | = | S-[(5-methoxy-oxo-4H-pyran-2-yl)methyl] O,O-dimethyl phosphorothioate |
| K62.42-1963 | diphenamid | = | N,N-dimethyl-2,2-diphenylacetamide |
| K62.43-1963 | trifluralin | = | α,α,α-trifluoro-2,6-dinitro-N,N-dipropyl-p-toluidine |
| K62.44-1962 | diquat | = | 6,7-dihydrodipyrido[1,2-a:2′,1′-c]pyrazidiinium salt |
| K62.45-1962 | paraquat | = | 1,1′-dimethyl-4,4′-bipyridinium salt |
| K62.46-1963 | swep | = | methyl 3,4-dichlorocarbanilate |
| K62.47-1963 | dicryl | chloranocryl | 3,4-dichloro-2-methylacrylanilide |
| K62.48-1963 | solan | pentanochlor | 3-chloro-2-methyl-p-valerotoluidide |
| K62.50-1963 | bromacil | = | 5-bromo-3-sec-butyl-6-methyluracil |
| K62.52-1963 | dichlobenil | = | 2,6-dichlorobenzonitrile |
| K62.53-1963 | norea | noruron | 3-(hexahydro-4,7-methanoindan-5-yl)-1,1-dimethylurea |
| K62.54-1963 | dioxathion | = | 2,3-p-dioxanedithiol S,S-bis(O,O-diethyl phosphorodithioate) |
| K62.55-1963 | dicamba | = | 3,6-dichloro-o-anisic acid |
| K62.56-1963 | tricamba | = | 3,5,6-trichloro-o-anisic acid |
| K62.57-1964 | norbormide | = | 5-(α-hydroxy-α-2-pyridylbenzyl)-7-(α-2-pyridylbenzylidene)-5-norbornene-2,3-dicarboximide |
| K62.58-1967 | amidithion | = | S-[[(2-methoxyethyl)carbamoyl]methyl] O,O-dimethyl phosphorodithioate |
| K62.59-1965 | cypromid | = | 3′,4′-dichlorocyclopropanecarboxanilide |
| K62.60-1965 | siduron | = | 1-(2-methylcyclohexyl)-3-phenylurea |
| K62.62-1966 | pyrazon | chloridazon | 5-amino-4-chloro-2-phenyl-3(2H)-pyridazinone |
| K62.63-1965 | lenacil | = | 3-cyclohexyl-6,7-dihydro-1H-cyclopentapyrimidine-2,4(3H,5H)-dione |
| K62.64-1966 | chloroneb | = | 1,4-dichloro-2,5-dimethoxybenzene |
| K62.65-1966 | bromoxynil | = | 3,5-dibromo-4-hydroxybenzonitrile |
| K62.66-1966 | terbacil | = | 3-tert-butyl-5-chloro-6-methyluracil |
| K62.67-1967 | phosalone | = | O,O-diethyl S-[(6-chloro-2-oxobenzoxazolin-3-yl)methyl] phosphorodithioate |
| K62.68-1966 | milneb | = | 3,3′-ethylenebis(tetrahydro-4,6-dimethyl-2H-1,3,5-thiadiazine-2-thione) |
| K62.70-1967 | methomyl | = | S-methyl N-[(methylcarbamoyl)oxy]thioacetimidate |
| K62.71-1968 | formetanate | = | m-[[(dimethylamino)methylene]amino)phenyl methylcarbamate |
| K62.73-1968 | benzadox | = | (benzamidooxy)acetic acid |
| K62.74-1968 | carbofuran | = | 2,3-dihydro-2,2-dimethyl-7-benzofuranyl methylcarbamate |
| K62.75-1968 | carbetamide | = | D-N-ethyllactamide carbanilate (ester) |
| K62.76-1968 | parinol | = | α,α-bis(p-chlorophenyl)-3-pyridinemethanol |
| K62.77-1968 | aldicarb | = | 2-methyl-2-(methylthio)propionaldehyde O-(methylcarbamoyl)oxime |
| K62.78-1968 | benomyl | = | methyl 1-(butylcarbamoyl)-2-benzimidazolecarbamate |
| K62.79-1969 | alorac | = | (Z)-2,3,5,5,5-pentachloro-4-oxo-2-pentenoic acid |
| K62.80-1969 | fluometuron | = | 1,1-dimethyl-3-(α,α,α-trifluoro-m-tolyl)urea |
| K62.82-1969 | metobromuron | = | 3-(p-bromophenyl)-1-methoxy-1-methylurea |
| K62.83-1969 | chloroxuron | = | 3-[p-(p-chlorophenoxy)phenyl]-1,1-dimethylurea |
| K62.84-1969 | oryzalin | = | 3,5-dinitro-N4,N4-dipropylsulfanilamide |
| K62.85-1969 | dichlormate | = | 3,4-dichlorobenzyl methylcarbamate |
| K62.86-1969 | phenmedipham | = | methyl m-hydroxycarbanilate m-methylcarbanilate |
| K62.87-1969 | dialifor | dialifos | O,O-diethyl phosphorodithioate S-ester with N-(2-chloro-1-mercaptoethyl)phthalimide |
| K62.88-1969 | alachlor | = | 2-chloro-2′,6-diethyl-N-(methoxymethyl)acetanilide |
| K62.89-1971 | delachlor | = | 2-chloro-N-(isobutoxymethyl)-2′,6′-acetoxylidide |
| K62.90-1971 | butachlor | = | N-(butoxymethyl)-2-chloro-2′,6′-diethylacetanilide |
| K62.91-1970 | chloramben | = | 3-amino-2,5-dichlorobenzoic acid |
| K62.92-1970 | ethephon | = | (2-chloroethyl)phosphonic acid |
| K62.94-1970 | karbutilate | = | tert-butylcarbamic acid ester with 3-(m-hydroxyphenyl)-1,1-dimethylurea |
| K62.95-1971 | cyprazine | = | 2-chloro-4-(cyclopropylamino)-6-(isopropylamino)-s-triazine |
| K62.96-1971 | isopropalin | = | 2,6-dinitro-N,N-dipropylcumidine |
| K62.97-1970 | carboxin | = | 5,6-dihydro-2-methyl-1,4-oxathiin-3-carboxanilide |
| K62.98-1971 | oxycarboxin | = | 5,6-dihydro-2-methyl-1,4-oxathiin-3-carboxanilide 4,4-dioxide |
| K62.99-1971 | asulam | = | methyl sulfanilylcarbamate |
| K62.100-1971 | triarimol | = | α-(2,4-dichlorophenyl)-α-phenyl-5-pyrimidinemethanol |
| K62.101-1971 | chlorothalonil | = | tetrachloroisophthalonitrile |
| K62.102-1971 | dichlozoline | = | 3-(3,5-dichloropheny1)-5,5-dimethy1-2,4-oxazolidinedione |
| K62.103-1971 | chlorpyrifos | = | O,O-diethyl O-(3,5,6-trichloro-2-pyridyl) phosphorothioate |
| K62.104-1971 | methazole | = | 2-(3,4-dichlorophenyl)-4-methyl-1,2,4-oxadiazolidine-3,5-dione |
| K62.105-1971 | leptophos | = | O-(4-bromo-2,5-dichlorophenyl) O-methyl phenylphosphonothioate |
| K62.106-1971 | tetramethrin | = | 1-cyclohexene-1,2-dicarboximidomethyl 2,2-dimethyl-3-(2-methylpropenyl)cyclopropanecarboxylate |
| K62.108-1971 | acetochlor | = | 2-chloro-N-(ethoxymethyl)-6′-ethyl-o-acetotoluidide |
| K62.109-1971 | ancymidol | = | α-cyclopropyl-α-(p-methoxphenyl)-5-pyrimidinemethanol |
| K62.110.1972 | crufomate | = | 4-tert-butyl-2-chlorophenyl methyl methylphosphoramidate |
| K62.111-1971 | fospirate | = | dimethyl 3,5,6-trichloro-2-pyridyl phosphate |
| K62.112-1971 | disugran | dicamba-methyl | methyl 3,6-dichloro-o-anisate |
| K62.113-1972 | chlorbromuron | = | 3-(4-bromo-3-chlorophenyl)-1-methoxy-1-methylurea |
| K62.114-1972 | chlordimeform | = | N′-(4-chloro-o-tolyl)-N,N-dimethylformamidine |
| K62.115-1972 | fluorodifen | = | p-nitrophenyl α,α,α-trifluoro-2-nitro-p-tolyl ether |
| K62.116-1972 | prynachlor | = | 2-chloro-N-(1-methyl-2-propynyl)acetanilide |
| K62.117-1972 | glyphosine | = | N,N-bis(phosphonomethyl)glycine |
| K62.118-1972 | mexacarbate | = | 4-(dimethylamino)-3,5-xylyl methylcarbamate |
| K62.119-1972 | dinoseb | = | 2-sec-butyl-4,6-dinitrophenol |
| K62.120-1972 | acephate | = | O,S-dimethyl acetylphosphoramidothioate |
| K62.121-1975 | bufencarb | = | 3-(1-methylbutyl)phenyl methylcarbamate + 3-(1-ethylpropyl)phenyl methylcarbamate (3:1) |
| K62.123-1972 | ethiolate | = | S-ethyl diethylthiocarbamate |
| K62.124-1972 | glyphosate | = | N-(phosphonomethyl)glycine |
| K62.125-1973 | norflurazon | = | 4-chloro-5-(methylamino)-2-(α,α,α-trifluoro-m-tolyl)-3(2H)-pyridazinone |
| K62.126-1972 | oxamyl | = | methyl N′,N′-dimethyl-N-[((methylcarbamoyl)oxy]-1-thiooxamimidate |
| K62.127-1972 | picloram | = | 4-amino-3,5,6-trichloropicolinic acid |
| K62.128-1972 | nitrapyrin | = | 2-chloro-6-(trichloromethyl)pyridine |
| K62.129-1972 | bentazon | bentazone | 3-isopropyl-1H-2,1,3-benzothiadiazin-4(3H)-one 2,2-dioxide |
| K62.130-1973 | chlorpyrifos-methyl | = | O,O-dimethyl O-(3,5,6-trichloro-2-pyridyl) phosphorothioate |
| K62.131-1973 | propargite | = | 2-(p-tert-butylphenoxy)cyclohexyl 2-propynyl sulfite |
| K62.132-1973 | methoprene | = | isopropyl (E,E)-11-methoxy-3,7,11-trimethyl-2,4-dodecadienoate |
| K62.133-1973 | ethoprop | ethoprophos | O-ethyl S,S-dipropyl phosphorodithioate |
| K62.134-1973 | methidathion | = | O,O-dimethyl phosphorodithioate S-ester with 4-(mercaptomethyl)-2-methoxy-1,3,4-thiadiazolin-5-one |
| K62.135-1973 | dipropetryn | = | 2-(ethylthio)-4,6-bis(isopropylamino)-s-triazine |
| K62.136-1973 | hydroprene | = | ethyl (E,E)-3,7,11-trimethyl-2,4-dodecadienoate |
| K62.137-1973 | kinoprene | = | 2-propynyl (E,E)-3,7,11-trimethyl-2,4-dodecadienoate |
| K62.138-1973 | bifenox | = | methyl 5-(2,4-dichlorophenoxy)-2-nitrobenzoate |
| K62.139-1973 | desmedipham | = | ethyl m-hydroxycarbanilate carbanilate (ester) |
| K62.140-1973 | fluchloralin | = | N-(2-chloroethyl)-α,α,α-trifluoro-2,6-dinitro-N-propyl-p-toluidine |
| K62.141-1973 | triprene | = | S-ethyl (E,E)-11-methoxy-3,7,11-trimethyl-2,4-dodecadienethioate |
| K62.142-1973 | ametryn | = | 2-(ethylamino)-4-(isopropylamino)-6-(methylthio)-s-triazine |
| K62.143-1973 | prometryn | = | 2,4-bis(isopropylamino)-6-(methylthio)-s-triazine |
| K62.144-1973 | prometon | = | 2,4-bis(isopropylamino)-6-methoxy-s-triazine |
| K62.145-1973 | propazine | = | 2-chloro-4,6-bis(isopropylamino)-s-triazine |
| K62.146-1973 | captafol | = | cis-N-[(1,1,2,2-tetrachloroethyl)thio]-4-cyclohexene-1,2-dicarboximide |
| K62.147-1973 | dioxacarb | = | o-1,3-dioxolan-2-ylphenyl methylcarbamate |
| K62.148-1973 | terbutryn | = | 2-(tert-butylamino)-4-(ethylamino)-6-(methylthio)-s-triazine |
| K62.149-1973 | terbuthylazine | = | 2-(tert-butylamino)-4-chloro-6-(ethylamino)-s-triazine |
| K62.150-1973 | chloropropylate | = | isopropyl 4,4′-dichlorobenzilate |
| K62.151-1973 | bromopropylate | = | isopropyl 4,4′-dibromobenzilate |
| K62.152-1973 | profluralin | = | N-(cyclopropylmethyl)-α,α,α-trifluoro-2,6-dinitro-N-propyl-p-toluidine |
| K62.153-1974 | oxadiazon | = | 2-tert-butyl-4-(2,4-dichloro-5-isopropoxyphenyl)-1,3,4-oxadiazolin-5-one |
| K62.154-1974 | butralin | = | 4-(1,1-dimethylethyl)-N-(1-methylpropyl)-2,6-dinitrobenzenamine |
| K62.155-1974 | malonoben | = | 2-[[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]methylene]propanedinitrile |
| K62.156-1974 | benzipram | = | 3,5-dimethyl-N-(1-methylethyl)-N-(phenylmethyl)benzamide |
| K62.157-1974 | cyprazole | = | N-[5-(2-chloro-1,1-dimethylethyl)-1,3,4-thiadiazol-2-yl]cyclopropanecarboxamide |
| K62.158-1974 | tebuthiuron | = | N-[5-(1,1-dimethylethyl)-1,3,4-thiadiazol-2-yl]-N,N′-dimethylurea |
| K62.159-1974 | butam | tebutam | 2,2-dimethyl-N-(1-methylethyl)-N-(phenylmethyl)propanamide |
| K62.160-1974 | cyperquat | = | 1-methyl-4-phenylpyridinium salts |
| K62.161-1974 | thiophanate-methyl | = | dimethyl [(1,2-phenylene)bis(iminocarbonothioyl)]bis[carbamate] |
| K62.162-1974 | pyroxychlor | = | 2-chloro-6-methoxy-4-(trichloromethyl)pyridine |
| K62.163-1974 | ditalimfos | = | O,O-diethyl (1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)phosphonothioate |
| K62.164-1974 | thiofanox | = | 3,3-dimethyl-1-(methylthio)-2-butanone O-[(methylamino)carbonyl]oxime |
| K62.165-1974 | fluoridamid | = | N-[4-methyl-3-[[(trifluoromethyl)sulfonyl]amino]phenyl]acetamide |
| K62.166-1974 | perfluidone | = | 1,1,1-trifluoro-N-[2-methyl-4-(phenylsulfonyl)phenyl]methanesulfonamide |
| K62.167-1974 | cisanilide | = | cis-2,5-dimethyl-N-phenyl-1-pyrrolidinecarboxamide |
| K62.168-1974 | procyazine | = | 2-[[4-chloro-6-(cyclopropylamino)-1,3,5-triazin-2-yl]amino]-2-methylpropanenitrile |
| K62.169-1974 | triforine | = | N,N′-[1,4-piperazinediylbis(2,2,2-trichloroethylidene)]bis[formamide] |
| K62.170-1974 | daminozide | = | butanedioic acid mono(2,2-dimethylhydrazide) |
| K62.171-1975 | triclopyr | = | [(3,5,6-trichloro-2-pyridinyl)oxy]acetic acid |
| K62.172-1974 | difenzoquat | = | 1,2-dimethyl-3,5-diphenyl-1H-pyrazolium salts |
| K62.173-1974 | dichlofenthion | = | O-(2,4-dichlorophenyl) O,O-diethyl phosphorothioate |
| K62.174-1974 | terbufos | = | S-[[(1,1-dimethylethyl)thio]methyl] O,O-diethyl phosphorodithioate |
| K62.175-1977 | pendimethalin | = | N-(1-ethylpropyl)-3,4-dimethyl-2,6-dinitrobenzenamine |
| K62.176-1974 | ethalfluralin | = | N-ethyl-N-(2-methyl-2-propenyl)-2,6-dinitro-4-(trifluoromethyl)benzenamine |
| K62.177-1974 | tricyclazole | = | 5-methyl-1,2,4-triazolo[3,4-b]benzothiazole |
| K62.178-1975 | prosulfalin | = | N-[[4-(dipropylamino)-3,5-dinitrophenyl]sulfonyl]-S,S-dimethylsulfilimine |
| K62.179-1974 | isopyrimol | = | α-(4-chlorophenyl)-α-(1-methylethyl)-5-pyrimidinemethanol |
| K62.180-1975 | temephos | = | O,O′-(thiodi-4,1-phenylene) bis(O,O-dimethyl phosphorothioate) |
| K62.181-1975 | secbumeton | = | N-ethyl-6-methoxy-N′-(1-methylpropyl)-1,3,5-triazine-2,4-diamine |
| K62.182-1976 | mefluidide | = | N-[2,4-dimethyl-5-[[(trifluoromethyl)sulfonyl]amino]phenyl]acetamide |
| K62.183-1976 | terbuchlor | = | N-(butoxymethyl)-2-chloro-N-[2-(1,1-dimethylethyl)-6-methylphenyl]acetamide |
| K62.184-1975 | cyhexatin | = | tricyclohexylhydroxystannane |
| K62.185-1976 | fenarimol | = | α-(2-chlorophenyl)-α-(4-chlorophenyl)-5-pyrimidinementhanol |
| K62.186-1977 | diamidafos | = | phenyl N,N′-dimethylphosphorodiamidate |
| K62.187-1977 | thiobencarb | = | S-[(4-chlorophenyl)methyl] diethylcarbamothioate |
| K62.188-1976 | tetrafluron | = | N,N-dimethyl-N′-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]urea |
| K62.189-1976 | dinitramine | = | N3,N3-diethyl-2,4-dinitro-6-(trifluoromethyl)-1,3-benzenediamine |
| K62.190-1977 | prodiamine | = | 2,4-dinitro-N3,N3-dipropyl-6-(trifluoromethyl)-1,3-benzenediamine |
| K62.191-1976 | buthidazole | = | 3-[5-(1,1-dimethylethyl)-1,3,4-thiadiazol-2-yl]-4-hydroxy-1-methyl-2-imidazolidinone |
| K62.192-1976 | nuarimol | = | α-(2-chlorophenyl)-α-(4-fluorophenyl)-5-pyrimidinemethanol |
| K62.193-1976 | fluridone | = | 1-methyl-3-phenyl-5-[3-(trifluoromethyl)phenyl]-4(1H)-pyridinone |
| K62.194-1977 | furophanate | = | methyl [[[2-[(2-furanylmethylene)amino]phenyl]amino]thioxomethyl]carbamate |
| K62.195-1977 | triazbutil | = | 4-butyl-4H-1,2,4-triazole |
| K62.196-1977 | nitrofluorfen | = | 2-chloro-1-(4-nitrophenoxy)-4-(trifluoromethyl)benzene |
| K62.197-1977 | oxyfluorfen | = | 2-chloro-1-(3-ethoxy-4-nitrophenoxy)-4-(trifluoromethyl)benzene |
| K62.198-1976 | metolachlor | = | 2-chloro-N-(2-ethyl-6-methylphenyl)-N-(2-methoxy-1-methylethyl)acetamide |
| K62.199-1977 | etrimfos | = | O-(6-ethoxy-2-ethyl-4-pyrimidinyl) O,O-dimethyl phosphorothioate |
| K62.200-1977 | thidiazuron | = | N-phenyl-N′-1,2,3-thiadiazol-5-ylurea |
| K62.201-1977 | diflubenzuron | = | N-[(4-chlorophenyl)amino]carbonyl]-2,6-difluorobenzamide |
| K62.202-1977 | methamidophos | = | O,S-dimethyl phosphoramidothioate |
| K62.203-1977 | amitraz | = | N′-(2,4-dimethylphenyl)-N-[[(2,4-dimethylphenyl)imino]methyl]-N-methylmethanimidamide |
| K62.204-1977 | nitrilacarb | = | 4,4-dimethyl-5-[[[(methylamino)carbonyl]oxy]imino]pentanenitrile |
| K62.205-1977 | diclofop | = | 2-(4-(2,4-dichlorophenoxy)phenoxy)propanoic acid |
| K62.206-1978 | fosamine | = | ethyl hydrogen (aminocarbonyl)phosphonate |
| K62.207-1977 | trifenofos | = | O-ethyl S-propyl O-(2,4,6-trichlorophenyl) phosphorothioate |
| K62.208-1977 | methalpropalin | = | N-(2-methyl-2-propenyl)-2,6-dinitro-N-propyl-4-(trifluoroethyl)benzenamine |
| K62.209-1978 | aldoxycarb | = | 2-methyl-2-(methylsulfonyl)propanal O-[(methylamino)carbonyl)]oxime |
| K62.210-1977 | pirimicarb | = | 2-(dimethylamino)-5,6-dimethyl-4-pyrimidinyl dimethylcarbamate |
| K62.211-1977 | pirimiphos-ethyl | = | O-[2-(diethylamino)-6-methyl-4-pyrimidinyl] O,O-diethyl phosphorothioate |
| K62.213-1977 | bupirimate | = | 5-butyl-2-(ethylamino)-6-methyl-4-pyrimidinyl dimethylsulfamate |
| K62.214-1978 | cambendichlor | = | (phenylimino)di-2,1-ethanediyl bis(3,6-dichloro-2-methoxybenzoate) |
| K62.215-1978 | acifluorfen | = | 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoic acid |
| K62.216-1977 | pirimiphos-methyl | = | O-[2-(diethylamino)-6-methyl-4-pyrimidinyl] O,O-dimethyl phosphorothioate |
| K62.217-1977 | permethrin | = | (3-phenoxyphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylate |
| K62.218-1978 | diethatyl | = | N-(chloroacetyl)-N-(2,6-diethylphenyl)glycine |
| K62.219-1978 | chlorthiophos | = | O-[2,5-dichloro-4-(methylthio)phenyl] O,O-diethyl phosphorothioate and the 2,4,5 and 4,5,2 isomers (73:14:13) |
| K62.220-1979 | thiodicarb | = | dimethyl N,N′-[thiobis[(methylimino)carbonyloxy]]bis[ethanimidothioate] |
| K62.221-1978 | hexazinone | = | 3-cyclohexyl-6-(dimethylamino)-1-methyl-1,3,5-triazine-2,4(1H,3H)-dione |
| K62.222-1979 | octhilinone | = | 2-octyl-3(2H)-isothiazolone |
| K62.223-1978 | ethofumesate | = | (±)-2-ethoxy-2,3-dihydro-3,3-dimethyl-5-benzofuranyl methanesulfonate |
| K62.224-1978 | profenofos | = | O-(4-bromo-2-chlorophenyl) O-ethyl S-propyl phosphorothioate |
| K62.225-1978 | pyrinuron | = | N-(4-nitrophenyl)-N′-(3-pyridinylmethyl)urea |
| K62.226-1979 | fosthietan | = | diethyl 1,3-dithietan-2-ylidenephosphoramidate |
| K62.227-1979 | fenapanil | = | α-butyl-α-phenyl-1H-imidazole-1-propanenitrile |
| K62.228-1979 | methfuroxam | = | 2,4,5-trimethyl-N-phenyl-3-furancarboxamide |
| K62.231-1978 | bendiocarb | = | 2,2-dimethyl-1,3-benzodioxol-4-yl methylcarbamate |
| K62.232-1978 | resmethrin | = | [5-(phenylmethyl)-3-furanyl]methyl 2,2-dimethyl-3-(2-methyl-1-propenyl)cyclopropanecarboxylate |
| K62.233-1978 | propetamphos | = | (E)-1-methylethyl 3-[[(ethylamino)methoxyphosphinothioyl]oxy]-2-butenoate |
| K62.234-1979 | brodifacoum | = | 3-[3-(4′-bromo[1,1′-biphenyl]-4-yl)-1,2,3,4-tetrahydro-1-naphthalenyl]-4-hydroxy-2H-1-benzopyran-2-one |
| K62.235-1979 | metalaxyl | = | N-(2,6-dimethylphenyl)-N-(methoxyacetyl)-DL-alanine methyl ester |
| K62.236-1981 | ofurace | = | 2-chloro-N-(2,6-dimethylphenyl)-N-(tetrahydro-2-oxo-3-furanyl)acetamide |
| K62.237-1979 | propamocarb | = | propyl [3-(dimethylamino)propyl]carbamate |
| K62.239-1979 | dikegulac | = | 2,3:4,6-bis-O-(1-methylethylidene)-α-L-xylo-2-hexulofuranosonic acid |
| K62.241-1980 | difenopenten | = | (E)-(±)-4-[4-[4-(trifluoromethyl)phenoxy]phenoxy]-2-pentenoic acid |
| K62.242-1980 | cymoxanil | = | 2-cyano-N-[(ethylamino)carbonyl]-2-(methoxyimino)acetamide |
| K62.243-1980 | bromethalin | = | N-methyl-2,4-dinitro-N-(2,4,6-tribromophenyl)-6-(trifluoromethyl)benzenamine |
| K62.244-1980 | prochloraz | = | N-propyl-N-[2-(2,4,6,-trichlorophenoxy)ethyl]-1H-imidazole-1-carboxamide |
| K62.245-1980 | cypermethrin | = | cyano(3-phenoxyphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylate |
| K62.246-1980 | imazalil | = | 1-[2-(2,4-dichlorophenyl)-2-(2-propenyloxy)ethyl]-1H-imidazole |
| K62.247-1981 | isouron | = | N′-[5-(1,1-dimethylethyl)-3-isoxazolyl]-N,N-dimethylurea |
| K62.248-1981 | carbosulfan | = | 2,3-dihydro-2,2-dimethyl-7-benzofuranyl [(dibutylamino)thio]methylcarbamate |
| K62.249-1981 | chlorsulfuron | = | 2-chloro-N-[[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)amino]carbonyl]benzenesulfonamide |
| K62.250-1981 | fenridazon | = | 1-(4-chlorophenyl)-1,4-dihydro-6-methyl-4-oxo-3-pyridazinecarboxylic acid |
| K62.251-1982 | flucythrinate | = | cyano(3-phenoxyphenyl)methyl 4-(difluoromethoxy)-α-(1-methylethyl)benzeneacetate |
| K62.252-1981 | cyromazine | = | N-cyclopropyl-1,3,5-triazine-2,4,6-triamine |
| K62.253-1981 | diazinon | = | O,O-diethyl O-[6-methyl-2-(1-methylethyl)-4-pyrimidinyl] phosphorothioate |
| K62.254-1983 | fenpirithrin | = | cyano(6-phenoxy-2-pyridinyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropancarboxylate |
| K62.255-1982 | pyroxyfur | = | 2-chloro-6-(2-furanylmethoxy)-4-(trichloromethyl)pyridine |
| K62.256-1982 | benzofluor | = | N-[4-(ethylthio)-2-(trifluoromethyl)phenyl]methanesulfonamide |
| K62.257-1982 | iprodione | = | 3-(3,5-dichlorophenyl)-N-(1-methylethyl)-2,4-dioxo-1-imidazolidinecarboxamide |
| K62.258-1982 | fluvalinate | = | N-[2-chloro-4-(trifluoromethyl)phenyl]-DL-valine (±)-cyano(3-phenoxyphenyl)methyl ester |
| K62.259-1982 | dimethipin | = | 2,3-dihydro-5,6-dimethyl-1,4-dithiin 1,1,4,4-tetraoxide |
| K62.260-1982 | flurprimidol | = | α-(1-methylethyl)-α-[4-(trifluoromethoxy)phenyl]-5-pyrimidinemethanol |
| K62.261-1982 | fluazifop | = | (±)-2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoic acid |
| K62.262-1984 | triarathene | = | 5-(4-chlorophenyl)-2,3-diphenylthiophene |
| K62.263-1983 | nifluridide | = | N-[2-amino-3-nitro-5-(trifluoromethyl)phenyl]-2,2,3,3-tetrafluoropropanamide |
| K62.265-1983 | sulfometuron | = | 2-[[[[(4,6-dimethyl-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]benzoic acid |
| K62.266-1985 | isoxaben | = | N-[3-(1-ethyl-1-methylpropyl)-5-isoxazoyl]-2,6-dimethoxybenzamide |
| K62.268-1983 | tridiphane | = | 2-(3,5-dichlorophenyl)-2-(2,2,2-trichloroethyl)oxirane |
| K62.269-1983 | fomesafen | = | 5-[2-chloro-4-(trifluoromethyl)phenoxy]-N-(methylsulfonyl)-2-nitrobenzamide |
| K62.270-1985 | hydramethylnon | = | tetrahydro-5,5-dimethyl-2(1H)-pyrimidinone [3-[4-(trifluoromethyl)phenyl]-1-[2-[4-(trifluoromethyl)phenyl]ethenyl-2-propenylidene]hydrazone |
| K62.271-1983 | benazolin | = | 4-chloro-2-oxo-3(2H)-benzothiazoleacetic acid |
| K62.272-1983 | haloxyfop | = | 2-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoic acid |
| K62.273-1984 | clopyralid | = | 3,6-dichloro-2-pyridinecarboxylic acid |
| K62.275-1984 | lactofen | = | (±)-2-ethoxy-1-methyl-2-oxoethyl 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2 nitrobenzoate |
| K62.276-1983 | trimethacarb | = | 3,4,5-trimethylphenyl methylcarbamate, mixture with 2,3,5-trimethylphenyl methylcarbamate (approximately 4:1) |
| K62.277-1985 | cloproxydim | = | (E,E)-(±)-2-[1-[[(3-chloro-2-propenyl)oxy]imino]butyl]-5-[2-(ethylthio)propyl]-3-hydroxy-2-cyclohexen-1-one |
| K62.278-1983 | metsulfuron | = | 2-[[[[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)amino]carbonyl]amino]sulfonyl]benzoic acid |
| K62.279-1985 | fenoxycarb | = | ethyl [2-(4-phenoxyphenoxy)ethyl]carbamate |
| K62.280-1984 | imazaquin | = | 2-(4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]-3-quinolinecarboxylic acid |
| K62.281-1986 | imazapyr | = | (±)-2-[4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]-3-pyridinecarboxylic acid |
| K62.282-1985 | cinmethylin | = | exo-1-methyl-4-(1-methylethyl)-2-[(2-methylphenyl)methoxy]-7-oxabicyclo[2.2.1]heptane |
| K62.283-1988 | metsulfovax | = | 2,4-dimethyl-N-phenyl-5-thiazolecarboxamide |
| K62.284-1991 | imazamethabenz | = | (±)-2-[4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]-4(and 5)-methylbenzoic acid (3:2) |
| K62.285-1984 | cyprofuram | = | (±)-N-(3-chlorophenyl)-N-(tetrahydro-2-oxo-3-furanyl)cyclopropanecarboxamide |
| K62.286-1986 | fluoroglycofen | = | carboxymethyl 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate |
| K62.287-1985 | fenoxaprop | = | (±)-2-[4-[(6-chloro-2-benzoxazolyl)oxy]phenoxy]propanoic acid |
| K62.288-1985 | abamectin | = | 5-O-demethylavermectin A1a + 5-O-demethyl-25-de(1-methylpropyl)-25-(1-methylethyl)avermectin A1a (4:1) |
| K62.289-1985 | paclobutrazol | = | β-[(4-chlorophenyl)methyl]-α-(1,1-dimethylethyl)-1H-1,2,4-triazole-1-ethanol |
| K62.290-1986 | clofentezine | = | 3,6-bis(2-chlorophenyl)-1,2,4,5-tetrazine |
| K62.291-1986 | fluazifop-P | = | (R)-2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoic acid |
| K62.292-1986 | bifenthrin | = | [1α,3α(Z)]-(±)-(2-methyl[1,1′-biphenyl]-3-yl)methyl 3-(2-chloro-3,3,3-trifluoro-1-propenyl)-2,2-dimethylcyclopropanecarboxylate |
| K62.293-1986 | myclobutanil | = | α-butyl-α-(4-chlorophenyl)-1H-1,2,4-triazole-1-propanenitrile |
| K62.294-1986 | imazethapyr | = | 2-[4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]-5-ethyl-3-pyridinecarboxylic acid |
| K62.295-1986 | chlorimuron | = | 2-[[[[(4-chloro-6-methoxy-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]benzoic acid |
| K62.296-1990 | amidochlor | = | N-acetylaminomethyl-2-chloro-N-2,6-diethylphenylacetamide |
| K62.297-1988 | bensulfuron | = | 2-[[[[[(4,6-dimethoxy-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]methyl]benzoic acid |
| K62.298-1986 | quizalofop | = | (±)-2-[4-[(6-chloro-2-quinoxalinyl)oxy]phenoxy]propanoic acid |
| K62.299-1986 | azaconazole | = | 1-[[2-(2,4-dichlorophenyl)-1,3-dioxolan-2-yl]methyl]-1H-1,2,4-triazole |
| K62.300-1989 | clomazone | = | 2-[(2-chlorophenyl)methyl]-4,4-dimethyl-3-isoxazolidinone |
| K62.301-1988 | pyrifenox | = | 1-(2,4-dichlorophenyl)-2-(3-pyridinyl)ethanone O-methyloxime |
| K62.302-1989 | cadusafos | = | O-ethyl S,S-bis(1-methylpropyl) phosphorodithioate |
| K62.303-1989 | forchlorfenuron | = | N-(2-chloro-4-pyridinyl)-N′-phenylurea |
| K62.304-1990 | flusilazole | = | 1-[[bis(4-fluorophenyl)methylsilyl]methyl]-1H-1,2,4-triazole |
| K62.305-1988 | isazofos | = | O-[5-chloro-1-(1-methylethyl)-1H-1,2,4-triazol-3-yl] O,O-diethyl phosphorothioate |
| K62.306-1990 | thifensulfuron | = | 3-[[[[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)amino]carbonyl]amino]sulfonyl]-2-thiophenecarboxylic acid |
| K62.307-1989 | clethodim | = | (E,E)-(±)-2-[1-[[(3-chloro-2-propenyl)oxy]imino]propyl]-5-[2-(ethylthio)propyl]-3-hydroxy-2-cyclohexen-1-one |
| K62.309-1990 | hexaconazole | = | (±)-α-butyl-α-(2,4-dichlorophenyl)-1H-1,2,4-triazole-1-ethanol |
| K62.310-1988 | diniconazole | = | (E)-(±)-β-[(2,4-dichlorophenyl)methylene]-α-(1,1-dimethylethyl)-1H-1,2,4-triazole-1-ethanol |
| K62.311-1988 | uniconazole | = | (E)-(±)-β-[(4-chlorophenyl)methylene]-α-(1,1-dimethylethyl)-1H-1,2,4-triazole-1-ethanol |
| K62.312-1990 | flurtamone | = | (±)-5-(methylamino)-2-phenyl-4-[3-(trifluoromethyl)phenyl]-3(2H)-furanone |
| K62.313-1990 | tefluthrin | = | [1α,3α(Z)]-(±)-(2,3,5,6-tetrafluoro-4-methylphenyl)methyl 3-(2-chloro-3,3,3-trifluoro-1-propenyl)-2,2-dimethylcyclopropanecarboxylate |
| K62.314-1990 | flutriafol | = | α-(2-fluorophenyl)-α-(4-fluorophenyl)-1H-1,2,4-triazole-1-ethanol |
| K62.315-1990 | halosafen | = | 5-[2-chloro-6-fluoro-4-(trifluoromethyl)phenoxy]-N-(ethylsulfonyl)-2-nitrobenzamide |
| K62.316-1990 | hexaflumuron | = | N-[[[3,5-dichloro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]amino]carbonyl]-2,6-difluorobenzamide |
| K62.317-1989 | dithiopyr | = | S,S-dimethyl 2-(difluoromethyl)-4-(2-methylpropyl)-6-(trifluoromethyl)-3,5-pyridinedicarbothioate |
| K62.319-1990 | tralomethrin | = | cyano(3-phenoxyphenyl)methyl 2,2-dimethyl-3-(1,2,2,2-tetrabromoethyl)cyclopropanecarboxylate |
| K62.321-1990 | butathiofos | = | O-[2-(1,1-dimethylethyl)-5-pyrimidinyl] O,O-diethyl phosphorothioate |
| K62.322-1990 | sulfluramid | = | N-ethyl-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-1-octanesulfonamide |
| K62.323-1990 | tribenuron | = | 2-[[[[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)methylamino]carbonyl]amino]sulfonyl]benzoic acid |
| K62.327-1991 | fenazaquin | = | 4-[2-[4-(1,1-dimethylethyl)phenyl]ethoxy]quinazoline |
| K62.328-1990 | fenpropathrin | = | cyano(3-phenoxyphenyl)methyl 2,2,3,3-tetramethylcyclopropanecarboxylate |
| K62.329-1991 | nicosulfuron | = | 2-[[[[(4,6-dimethoxy-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]-N,N-dimethyl-3-pyridinecarboxamide |
| K62.330-1992 | rimsulfuron | = | N-[[(4,6-dimethoxy-2-pyrimidinyl)amino]carbonyl]-3-(ethylsulfonyl)-2-pyridinesulfonamide |
| K62.331-1992 | ethametsulfuron | = | 2-[[[[[4-ethoxy-6-(methylamino)-1,3,5-triazin-2-yl]amino]carbonyl]amino]sulfonyl]benzoic acid |
| K62.332-1992 | chlorethoxyfos | = | O,O-diethyl O-(1,2,2,2-tetrachloroethyl) phosphorothioate |
| K62.333-1992 | fenbuconazole | = | α-[2-(4-chlorophenyl)ethyl]-α-phenyl-1H-1,2,4-triazole-1-propanenitrile |
| K62.334-1991 | glufosinate | = | 2-amino-4-(hydroxymethylphosphinyl)butanoic acid |
| K62.335-1992 | debacarb | = | 2-(2-ethoxyethoxy)ethyl 1H-benzimidazol-2-ylcarbamate |
| K62.336-1993 | zeta-cypermethrin | = | cyano(3-phenoxyphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylate |
| K62.337-1993 | flumetsulam | = | N-(2,6-difluorophenyl)-5-methyl[1,2,4]triazolo[1,5-a]pyrimidine-2-sulfonamide |
| K62.338-1993 | emamectin | = | (4″R)-5-O-demethyl-4″-deoxy-4″-(methylamino)avermectin A1a + (4″R)-5-O-demethyl-25-de(1-methylpropyl)-4″-deoxy-4″-(methylamino)-25-(1-methylethyl)avermectin A1a (9:1) |
| K62.339-1993 | tebufenozide | = | 3,5-dimethylbenzoic acid 1-(1,1-dimethylethyl)-2-(4-ethylbenzoyl)hydrazide |
| K62.340-1993 | thifluzamide | = | N-[2,6-dibromo-4-(trifluoromethoxy)phenyl]-2-methyl-4-(trifluoromethyl)-5-thiazolecarboxamide |
| K62.341-1993 | triflusulfuron | = | 2-[[[[[4-(dimethylamino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]carbonyl]amino]sulfonyl]-3-methylbenzoic acid |
| K62.342-1993 | thiazopyr | = | methyl 2-(difluoromethyl)-5-(4,5-dihydro-2-thiazolyl)-4-(2-methylpropyl)-6-(trifluoromethyl)-3-pyridinecarboxylate |
| K62.343-1995 | flupropacil | = | 1-methylethyl 2-chloro-5-[3,6-dihydro-3-methyl-2,6-dioxo-4-(trifluoromethyl)-1(2H)-pyrimidinyl]benzoate |
| K62.344-1993 | nithiazine | = | tetrahydro-2-(nitromethylene)-2H-1,3-thiazine |
| K62.345-1993 | sulfentrazone | = | N-[2,4-dichloro-5-[4-(difluoromethyl)-4,5-dihydro-3-methyl-5-oxo-1H-1,2,4-triazol-1-yl]phenyl]methanesulfonamide |
| K62.346-1993 | metosulam | = | N-(2,6-dichloro-3-methylphenyl)-5,7-dimethoxy[1,2,4]triazolo[1,5-a]pyrimidine-2-sulfonamide |
| K62.348-1995 | azimsulfuron | = | N-[[(4,6-dimethoxy-2-pyrimidinyl)amino]carbonyl]-1-methyl-4-(2-methyl-2H-tetrazol-5-yl)-1H-pyrazole-5-sulfonamide |
| K62.349-1995 | clofencet | = | 2-(4-chlorophenyl)-3-ethyl-2,5-dihydro-5-oxo-4-pyridazinecarboxylic acid |
| K62.350-1994 | flumiclorac | = | 2-chloro-4-fluoro-5-(1,3,4,5,6,7-hexahydro-1,3-dioxo-2H-isoindol-2-yl)phenoxyacetic acid |
| K62.351-1997 | chlorfenapyr | = | 4-bromo-2-(4-chlorophenyl)-1-(ethoxymethyl)-5-(trifluoromethyl)-1H-pyrrole-3-carbonitrile |
| K62.352-1994 | pyrithiobac | = | 2-chloro-6-(4,6-dimethoxy-2-pyrimidinyl)thiobenzoic acid |
| K62.353-1995 | cyclosulfamuron | = | N-2-(cyclopropylcarbonyl)phenylaminosulfonyl-N′-(4,6-dimethoxy-2-pyrimidinyl)urea |
| K62.354-1995 | cyhalofop | = | (R)-2-[4-(4-cyano-2-fluorophenoxy)phenoxy]propanoic acid |
| K62.355-1997 | flupyrsulfuron | = | 2-[[[[(4,6-dimethoxy-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]-6-(trifluoromethyl)-3-pyridinecarboxylic acid |
| K62.356-1997 | carfentrazone | = | α,2-dichloro-5-[4-(difluoromethyl)-4,5-dihydro-3-methyl-5-oxo-1H-1,2,4-triazol-1-yl]-4-fluorobenzenepropanoic acid |
| K62.357-1994 | flumioxazin | = | 2-[7-fluoro-3,4-dihydro-3-oxo-4-(2-propyn-1-yl)-2H-1,4-benzoxazin-6-yl]-4,5,6,7-tetrahydro-1H-isoindole-1,3(2H)-dione |
| K62.358-1997 | imazamox | = | 2-(4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl)-5-(methoxymethyl)-3-pyridinecarboxylic acid |
| K62.359-1997 | polyoxorim | = | 5-[[2-amino-5-O-(aminocarbonyl)-2-deoxy-L-xylonoyl]amino]-1-(5-carboxy-3,4-dihydro-2,4-dioxo-1(2H)-pyrimidinyl)-1,5-dideoxy-β-D-allofuranuronic acid |
| K62.360-1997 | famoxadone | = | 5-methyl-5-(4-phenoxyphenyl)-3-(phenylamino)-2,4-oxazolidinedione |
| K62.361-1997 | azafenidin | = | 2-[2,4-dichloro-5-(2-propynyloxy)phenyl]-5,6,7,8-tetrahydro-1,2,4-triazolo[4,3-a]pyridin-3(2H)-one |
| K62.362-1997 | spinosad | = | [2R-[2R*,3aS*,5aR*,5bS*,9S*,13S*(2R*,5S*,6R*),14R*,16aS*,16bR*]]-2-[(6-deoxy-2,3,4-tri-O-methyl-α-L-mannopyranosyl)oxy]-13-[[5-(dimethylamino)tetrahydro-6-methyl-2H-pyran-2-yl]oxy]-9-ethyl-2,3,3a,5a,5b,6,9,10,11,12,13,14,16a,16b-tetradecahydro-14-methyl-1H-as-indaceno[3,2-d]oxacyclododecin-7,15-dione + [2S-[2R*,3aS*,5aR*,5bR*,9R*,13R*(2S*,5R*,6S*),14S*,16aR*,16bR*]]-2-[(6-deoxy-2,3,4-tri-O-methyl-α-L-mannopyranosyl)oxy]-13-[[5-(dimethylamino)tetrahydro-6-methyl-2H-pyran-2-yl]oxy]-9-ethyl-2,3,3a,5a,5b,6,9,10,11,12,13,14,16a,16b-tetradecahydro-4,14-dimethyl-1H-as-indaceno[3,2-d]oxacyclododecin-7,15-dione |
| K62.364-1997 | halofenozide | = | 4-chlorobenzoic acid 2-benzoyl-2-(1,1-dimethylethyl)hydrazide |
| K62.365-1998 | indoxacarb | = | (S)-methyl 7-chloro-2,5-dihydro-2-[[(methoxycarbonyl)[4-(trifluoromethoxy)phenyl]amino]carbonyl]indeno[1,2-e][1,3,4]oxadiazine-4a(3H)-carboxylate |
| K62.366-1997 | quinoxyfen | = | 5,7-dichloro-4-(4-fluorophenoxy)quinoline |
| K62.367-1997 | cloransulam | = | 3-chloro-2-[[(5-ethoxy-7-fluoro[1,2,4]triazolo[1,5-c]pyrimidin-2-yl)sulfonyl]amino]benzoic acid |
| K62.368-1997 | diclosulam | = | N-(2,6-dichlorophenyl)-5-ethoxy-7-fluoro[1,2,4]triazolo[1,5-c]pyrimidine-2-sulfonamide |
| K62.369-1997 | fluroxypyr | = | [(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetic acid |
| K62.370-1997 | bifenazate | = | 1-methylethyl 2-(4-methoxy[1,1′-biphenyl]-3-yl)hydrazinecarboxylate |
| K62.371-1998 | methoxyfenozide | = | 3-methoxy-2-methylbenzoic acid 2-(3,5-dimethylbenzoyl)-2-(1,1-dimethylethyl)hydrazide |
| K62.372 | flupyrazofos | = | O,O-diethyl O-[1-phenyl-3-(trifluoromethyl)-1H-pyrazol-5-yl] phosphorothioate |
| Number | ANSI name | ISO name | Systematic name in title of standard |
|---|---|---|---|
| K62.4 | |||
| K62.5 | |||
| K62.17 | |||
| K62.49 | |||
| K62.51 | |||
| K62.61 | |||
| K62.69 | |||
| K62.72 | |||
| K62.81 | |||
| K62.93 | |||
| K62.107 | |||
| K62.122 | |||
| K62.212 | |||
| K62.229 | |||
| K62.230 | |||
| K62.238 | |||
| K62.240 | |||
| K62.264 | |||
| K62.267 | |||
| K62.274 | |||
| K62.308 | |||
| K62.318 | |||
| K62.320 | |||
| K62.324 | |||
| K62.325 | |||
| K62.326 | |||
| K62.347 | |||
| K62.363 |
Alan Wood (ISO 1750 Maintenance Agency)
22nd November 2025