thiosemicarbazide

Chinese: 灭鼠特French: thiosemicarbazide (n.f.)Russian: тиосемикарбазид


Approval: ISO common name not required
IUPAC PIN: hydrazinecarbothioamide
IUPAC name: hydrazinecarbothioamide
CAS name: hydrazinecarbothioamide
CAS Reg. No.: 79-19-6
Formula: CH5N3S
Activity: rodenticides (thiourea)
Notes: This substance is considered by the International Organization for Standardization not to require a common name.
Structure: Structural formula of thiosemicarbazide
Pronunciation: thī-ō-sěm-ē-karb-a-zīd  Guide to British pronunciation
InChIKey: BRWIZMBXBAOCCF-UHFFFAOYSA-N
InChI: InChI=1S/CH5N3S/c2-1(5)4-3/h3H2,(H3,2,4,5)

A data sheet from the Compendium of Pesticide Common Names