| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | diethyl 4,4′-(o-phenylene)bis(3-thioallophanate) |
| CAS: | diethyl N,N′-[1,2-phenylenebis(iminocarbonothioyl)]bis[carbamate] |
| Reg. No.: | 23564-06-9 |
| Formula: | C14H18N4O4S2 |
| Activity: | fungicides (benzimidazole precursor fungicides; carbamate fungicides) |
| Notes: | * The name “thiophanate-éthyl” (n.m.) is used in France. The analogous dimethyl ester has the ISO common name thiophanate-methyl. |
| Structure: | ![]() |
| Pronunciation: | thī-ǒf-an-āt Guide to British pronunciation |
| InChIKey: | YFNCATAIYKQPOO-UHFFFAOYSA-N |
| InChI: | InChI=1S/C14H18N4O4S2/c1-3-21-13(19)17-11(23)15-9-7-5-6-8-10(9)16-12(24)18-14(20)22-4-2/h5-8H,3-4H2,1-2H3,(H2,15,17,19,23)(H2,16,18,20,24) |
A data sheet from the Compendium of Pesticide Common Names