Approval: | ISO |
---|---|
IUPAC PIN: | N,N-dimethyl-1,2,3-trithian-5-amine |
IUPAC name: | dimethyl(1,2,3-trithian-5-yl)amine 1979 Rules: N,N-dimethyl-1,2,3-trithian-5-ylamine |
CAS name: | N,N-dimethyl-1,2,3-trithian-5-amine |
CAS Reg. No.: | 31895-21-3 |
Formula: | C5H11NS3 |
Activity: | insecticides (nereistoxin analogue) |
Notes: | Derivatives include thiocyclam hydrochloride [75655-75-3] (for which the name “trithialan” (杀虫钉) is approved in China), thiocyclam oxalate [31895-22-4]. |
Structure: | |
Pronunciation: | thī-ō-sī-klǎm Guide to British pronunciation |
InChIKey: | DNVLJEWNNDHELH-UHFFFAOYSA-N |
InChI: | InChI=1S/C5H11NS3/c1-6(2)5-3-7-9-8-4-5/h5H,3-4H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names