| Status: |
ISO 1750 (published) |
| IUPAC: |
N,N-dimethyl-1,2,3-trithian-5-ylamine |
| CAS: |
N,N-dimethyl-1,2,3-trithian-5-amine |
| Reg. No.: |
31895-21-3 |
| Formula: |
C5H11NS3 |
| Activity: |
insecticides (nereistoxin analogue insecticides) |
| Notes: |
When this substance is used as a salt, its identity should be stated, for example thiocyclam hydrochloride (for which the name “trithialan” (杀虫钉) is approved in China), thiocyclam oxalate [31895-22-4]. |
| Structure: |
 |
| Pronunciation: |
thī-ō-sī-klǎm Guide to British pronunciation |
| InChIKey: |
DNVLJEWNNDHELH-UHFFFAOYSA-N |
| InChI: |
InChI=1S/C5H11NS3/c1-6(2)5-3-7-9-8-4-5/h5H,3-4H2,1-2H3 |