Status: | ISO 765 (published) |
---|---|
IUPAC name: | strychnidin-10-one |
CAS name: | strychnidin-10-one |
CAS Reg. No.: | 57-24-9 |
Formula: | C21H22N2O2 |
Activity: | avicides rodenticides (alkaloid) |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. The Chinese name “毒鼠碱” has also been used in the literature, but it has no official status. |
Structure: | |
Pronunciation: | strǐk-nēn Guide to British pronunciation |
InChIKey: | QMGVPVSNSZLJIA-FVWCLLPLSA-N |
InChI: | InChI=1S/C21H22N2O2/c24-18-10-16-19-13-9-17-21(6-7-22(17)11-12(13)5-8-25-16)14-3-1-2-4-15(14)23(18)20(19)21/h1-5,13,16-17,19-20H,6-11H2/t13-,16-,17-,19-,20-,21+/m0/s1 |
A data sheet from the Compendium of Pesticide Common Names