Approval: | ISO common name not required |
---|---|
IUPAC name: | sodium chlorate |
CAS name: | sodium chlorate |
CAS Reg. No.: | 7775-09-9 |
Formula: | ClNaO3 |
Activity: | herbicides (inorganic) |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
Structure: | |
Pronunciation: | sō-dē-am klor-āt Guide to British pronunciation |
InChIKey: | YZHUMGUJCQRKBT-UHFFFAOYSA-M |
InChI: | InChI=1S/ClHO3.Na/c2-1(3)4;/h(H,2,3,4);/q;+1/p-1 |
A data sheet from the Compendium of Pesticide Common Names