| Status: | China |
|---|---|
| IUPAC: | copper salt of 5,5′-(methylenediimino)bis(1,3,4-thiadiazole-2-thiol) |
| CAS: | 5,5′-(methylenediimino)bis[1,3,4-thiadiazole-2(3H)-thione] copper(2+) salt (1:1) |
| Reg. No.: | |
| Formula: | C5H4CuN6S4 |
| Activity: | bactericides fungicides (copper fungicides; thiadiazole fungicides) |
| Notes: | There is no ISO common name for this substance; the name “saisentong” (噻森铜) is approved in China. This substance is the copper salt of bismerthiazol. |
| Structure: | ![]() |
| Pronunciation: | Guide to British pronunciation |
| InChIKey: | KREMDFWHXPNVQL-UHFFFAOYSA-L |
| InChI: | InChI=1S/C5H6N6S4.Cu/c12-4-10-8-2(14-4)6-1-7-3-9-11-5(13)15-3;/h1H2,(H,6,8)(H,7,9)(H,10,12)(H,11,13);/q;+2/p-2 |
A data sheet from the Compendium of Pesticide Common Names