Status: | WHO INN |
---|---|
IUPAC PIN: | N-[3-chloro-4-(4-chlorophenoxy)phenyl]-2-hydroxy-3,5-diiodobenzamide |
IUPAC name: | 3′-chloro-4′-(4-chlorophenoxy)-2-hydroxy-3,5-diiodobenzanilide 1979 Rules: 3′-chloro-4′-(4-chlorophenoxy)-3,5-diiodosalicylanilide |
CAS name: | N-[3-chloro-4-(4-chlorophenoxy)phenyl]-2-hydroxy-3,5-diiodobenzamide |
CAS Reg. No.: | 22662-39-1 |
Formula: | C19H11Cl2I2NO3 |
Activity: | insecticides (unclassified) |
Notes: | There is no ISO common name for this substance; the name “rafoxanide” is approved by the World Health Organization. |
Structure: | |
Pronunciation: | rǎ-fǒks-a-nīd Guide to British pronunciation |
InChIKey: | NEMNPWINWMHUMR-UHFFFAOYSA-N |
InChI: | InChI=1S/C19H11Cl2I2NO3/c20-10-1-4-13(5-2-10)27-17-6-3-12(9-15(17)21)24-19(26)14-7-11(22)8-16(23)18(14)25/h1-9,25H,(H,24,26) |
A data sheet from the Compendium of Pesticide Common Names