Status: | China |
---|---|
IUPAC PIN: | ethyl 3-(N-butylacetamido)propanoate |
IUPAC name: | ethyl N-acetyl-N-butyl-β-alaninate or ethyl 3-[acetyl(butyl)amino]propanoate |
CAS name: | ethyl N-acetyl-N-butyl-β-alaninate |
CAS Reg. No.: | 52304-36-6 |
Formula: | C11H21NO3 |
Activity: | insect repellents |
Notes: | There is no ISO common name for this substance; the name “quwenzhi” (驱蚊酯) is approved in China. Typcially referred to in the literature by the tradename IR3535®. Also known as EBAAP. |
Structure: | |
Pronunciation: | Guide to British pronunciation |
InChIKey: | VZRKEAFHFMSHCD-UHFFFAOYSA-N |
InChI: | InChI=1S/C11H21NO3/c1-4-6-8-12(10(3)13)9-7-11(14)15-5-2/h4-9H2,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names