Status: | ISO 1750 (published) |
---|---|
IUPAC PIN: | {2-chloro-5-[4-chloro-5-(difluoromethoxy)-1-methyl-1H-pyrazol-3-yl]-4-fluorophenoxy}acetic acid |
IUPAC name: | {2-chloro-5-[4-chloro-5-(difluoromethoxy)-1-methyl-1H-pyrazol-3-yl]-4-fluorophenoxy}acetic acid |
CAS name: | 2-[2-chloro-5-[4-chloro-5-(difluoromethoxy)-1-methyl-1H-pyrazol-3-yl]-4-fluorophenoxy]acetic acid |
CAS Reg. No.: | 129630-17-7 |
Formula: | C13H9Cl2F3N2O4 |
Activity: | herbicides (phenylpyrazole) |
Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example pyraflufen-ethyl [129630-19-9]. |
Structure: | |
Pronunciation: | pīr-a-floo-fěn Guide to British pronunciation |
InChIKey: | YXIIPOGUBVYZIW-UHFFFAOYSA-N |
InChI: | InChI=1S/C13H9Cl2F3N2O4/c1-20-12(24-13(17)18)10(15)11(19-20)5-2-8(23-4-9(21)22)6(14)3-7(5)16/h2-3,13H,4H2,1H3,(H,21,22) |
A data sheet from the Compendium of Pesticide Common Names