| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]imidazole-1-carboxamide |
| CAS: | N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]-1H-imidazole-1-carboxamide |
| Reg. No.: | 67747-09-5 |
| Formula: | C15H16Cl3N3O2 |
| Activity: | fungicides (amide fungicides; conazole fungicides) |
| Notes: | When this substance is used as a complex, its identity should be stated, for example prochloraz-manganese [69192-23-0]. |
| Structure: | ![]() |
| Pronunciation: | prō-klor-ǎz Guide to British pronunciation |
| InChIKey: | TVLSRXXIMLFWEO-UHFFFAOYSA-N |
| InChI: | InChI=1S/C15H16Cl3N3O2/c1-2-4-20(15(22)21-5-3-19-10-21)6-7-23-14-12(17)8-11(16)9-13(14)18/h3,5,8-10H,2,4,6-7H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names