phenylmercury derivative of pyrocatechol

French: pyrocatécholate phénylmercurique (n.m.)


Status: ISO 765 (published)
IUPAC name: o-(phenylmercuriooxy)phenol
or
phenylmercuric pyrocatecholate
CAS name: (2-hydroxyphenolato-κO1O2)phenylmercury
CAS Reg. No.:
Formula: C12H10HgO2
Activity: fungicides (mercury compound)
Notes: This substance is considered by the International Organization for Standardization not to require a common name.
Structure: Structural formula of phenylmercury derivative of pyrocatechol
Pronunciation: -nīl-mer-kūr-ē dǐ-rǐv-a-tǐv ǒv pīr-ō-kǎt-ǐ-chǒl  Guide to British pronunciation
InChIKey: IGENIDGVUSKDCC-UHFFFAOYSA-M
InChI: InChI=1S/C6H6O2.C6H5.Hg/c7-5-3-1-2-4-6(5)8;1-2-4-6-5-3-1;/h1-4,7-8H;1-5H;/q;;+1/p-1

A data sheet from the Compendium of Pesticide Common Names