Status: | ISO 765 (published) |
---|---|
IUPAC name: | o-(phenylmercuriooxy)phenol or phenylmercuric pyrocatecholate |
CAS name: | (2-hydroxyphenolato-κO1,κO2)phenylmercury |
CAS Reg. No.: | |
Formula: | C12H10HgO2 |
Activity: | fungicides (mercury compound) |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
Structure: | |
Pronunciation: | fē-nīl-mer-kūr-ē dǐ-rǐv-a-tǐv ǒv pīr-ō-kǎt-ǐ-chǒl Guide to British pronunciation |
InChIKey: | IGENIDGVUSKDCC-UHFFFAOYSA-M |
InChI: | InChI=1S/C6H6O2.C6H5.Hg/c7-5-3-1-2-4-6(5)8;1-2-4-6-5-3-1;/h1-4,7-8H;1-5H;/q;;+1/p-1 |
A data sheet from the Compendium of Pesticide Common Names