| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 1,1-dimethyl-3-[(3aRS,4SR,5RS,7SR,7aRS)-perhydro-4,7-methanoinden-5-yl]urea or 3-[(3aRS,4SR,5RS,7SR,7aRS)-hexahydro-4,7-methanoindan-5-yl]-1,1-dimethylurea |
| CAS: | rel-N,N-dimethyl-N′-[(3aR,4S,5R,7S,7aR)-octahydro-4,7-methano-1H-inden-5-yl]urea |
| Reg. No.: | 18530-56-8 |
| Formula: | C13H22N2O |
| Activity: | herbicides (urea herbicides) |
| Notes: | The name “norea” is approved by the American National Standards Institute and the Weed Science Society of America. |
| Structure: | ![]() |
| Pronunciation: | nor-ūr-ǒn Guide to British pronunciation |
| InChI: | InChI=1/C13H22N2O/c1-15(2)13(16)14-12-7-8-6-11(12)10-5-3-4-9(8)10/h8-12H,3-7H2,1-2H3,(H,14,16)/t8-,9+,10+,11-,12+/s3/f/h14H |
A data sheet from the Compendium of Pesticide Common Names