Approval: | ISO |
---|---|
IUPAC PIN: | rac-(2R)-N,N-diethyl-2-(naphthalen-1-yloxy)propanamide |
IUPAC name: | (2RS)-N,N-diethyl-2-(1-naphthyloxy)propanamide 1979 Rules: (RS)-N,N-diethyl-2-(1-naphthyloxy)propionamide |
CAS name: | N,N-diethyl-2-(1-naphthalenyloxy)propanamide |
CAS Reg. No.: | 15299-99-7 |
Formula: | C17H21NO2 |
Activity: | herbicides (acetamide) |
Notes: | The (−)-enantiomer of this substance has the ISO common name napropamide-M [41643-35-0]. |
Structure: | |
Pronunciation: | nǎ-prō-pa-mīd Guide to British pronunciation |
InChIKey: | WXZVAROIGSFCFJ-UHFFFAOYSA-N |
InChI: | InChI=1S/C17H21NO2/c1-4-18(5-2)17(19)13(3)20-16-12-8-10-14-9-6-7-11-15(14)16/h6-13H,4-5H2,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names