| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 4-methylthio-3,5-xylyl methylcarbamate |
| CAS: | 3,5-dimethyl-4-(methylthio)phenyl N-methylcarbamate |
| Reg. No.: | 2032-65-7 |
| Formula: | C11H15NO2S |
| Activity: | acaricides (carbamate acaricides) bird repellents insecticides (phenyl methylcarbamate insecticides) molluscicides |
| Notes: | The common name “mercaptodimethur” is also approved by ISO. |
| Structure: | ![]() |
| Pronunciation: | mě-thī-ō-karb Guide to British pronunciation |
| InChIKey: | YFBPRJGDJKVWAH-UHFFFAOYSA-N |
| InChI: | InChI=1S/C11H15NO2S/c1-7-5-9(14-11(13)12-3)6-8(2)10(7)15-4/h5-6H,1-4H3,(H,12,13) |
A data sheet from the Compendium of Pesticide Common Names