Status: | none |
---|---|
IUPAC PIN: | (3E,5Z)-tetradeca-3,5-dienoic acid |
IUPAC name: | (3E,5Z)-tetradeca-3,5-dienoic acid or (Z,E)-tetradeca-3,5-dienoic acid |
CAS name: | (3E,5Z)-3,5-tetradecadienoic acid |
CAS Reg. No.: | 23400-52-4 |
Formula: | C14H24O2 |
Activity: | insect attractants (Coleopteran) |
Notes: | There is no ISO common name for this substance; the name “megatomoic acid” has been used in the literature but it has no official status. This substance is named after the insect from which it was isolated, Attagenus megatoma (Fabricius) (Dermestidae, Coloptera). |
Structure: | |
Pronunciation: | měg-a-tō-mō-ǐk ǎs-ǐd Guide to British pronunciation |
InChIKey: | YRUMHTHCEZRHTN-XAZJVICWSA-N |
InChI: | InChI=1S/C14H24O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h9-12H,2-8,13H2,1H3,(H,15,16)/b10-9-,12-11+ |
A data sheet from the Compendium of Pesticide Common Names