| Status: | China |
|---|---|
| IUPAC PIN: | 2-(dichloromethyl)-2-methyl-1,3-dioxolane |
| IUPAC name: | 2-(dichloromethyl)-2-methyl-1,3-dioxolane |
| CAS name: | 2-(dichloromethyl)-2-methyl-1,3-dioxolane |
| CAS Reg. No.: | 22052-63-7 |
| Formula: | C5H8Cl2O2 |
| Activity: | herbicide safeners |
| Notes: | There is no ISO common name for this substance; the name “jiecaowan” (解草烷) is approved in China. The CAS Registry Number 96420-72-3 was formerly used. |
| Structure: |  |
| Pronunciation: | Guide to British pronunciation |
| InChIKey: | OHXLAOJLJWLEIP-UHFFFAOYSA-N |
| InChI: | InChI=1S/C5H8Cl2O2/c1-5(4(6)7)8-2-3-9-5/h4H,2-3H2,1H3 |