Approval: | ISO |
---|---|
IUPAC PIN: | 4-hydroxy-3,5-diiodobenzonitrile |
IUPAC name: | 4-hydroxy-3,5-diiodobenzonitrile |
CAS name: | 4-hydroxy-3,5-diiodobenzonitrile |
CAS Reg. No.: | 1689-83-4 |
Formula: | C7H3I2NO |
Activity: | herbicides (hydroxybenzonitrile) |
Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example ioxynil-lithium [2961-61-7], ioxynil octanoate [3861-47-0], ioxynil-sodium [2961-62-8]. |
Structure: | |
Pronunciation: | ī-ǒks-ǐ-nǐl Guide to British pronunciation |
InChIKey: | NRXQIUSYPAHGNM-UHFFFAOYSA-N |
InChI: | InChI=1S/C7H3I2NO/c8-5-1-4(3-10)2-6(9)7(5)11/h1-2,11H |
A data sheet from the Compendium of Pesticide Common Names