| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 1,1-dimethyl-3-phenylurea |
| CAS: | N,N-dimethyl-N′-phenylurea |
| Reg. No.: | 101-42-8 |
| Formula: | C9H12N2O |
| Activity: | herbicides (phenylurea herbicides) |
| Notes: | When this substance is used as a salt, its identity should be stated, for example fenuron TCA [4482-55-7]; the name “fenuron-TCA” is approved by the Weed Science Society of America for this substance. The name “fenidin” (фенидин) was used in the former USSR. |
| Structure: |  |
| Pronunciation: | fěn-ūr-ǒn Guide to British pronunciation |
| InChIKey: | XXOYNJXVWVNOOJ-UHFFFAOYSA-N |
| InChI: | InChI=1S/C9H12N2O/c1-11(2)9(12)10-8-6-4-3-5-7-8/h3-7H,1-2H3,(H,10,12) |