| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 1-(4-chlorophenyl)-1,4-dihydro-6-methyl-4-oxopyridazine-3-carboxylic acid |
| CAS: | 1-(4-chlorophenyl)-1,4-dihydro-6-methyl-4-oxo-3-pyridazinecarboxylic acid |
| Reg. No.: | 68254-10-4 |
| Formula: | C12H9ClN2O3 |
| Activity: | plant growth regulators (gametocides) |
| Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example fenridazon-potassium [83588-43-6], fenridazon-propyl. |
| Structure: | ![]() |
| Pronunciation: | fěn-rǐd-a-zǒn Guide to British pronunciation |
| InChIKey: | JDEKUYKSOCTBJT-UHFFFAOYSA-N |
| InChI: | InChI=1S/C12H9ClN2O3/c1-7-6-10(16)11(12(17)18)14-15(7)9-4-2-8(13)3-5-9/h2-6H,1H3,(H,17,18) |
A data sheet from the Compendium of Pesticide Common Names