| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | (RS)-2-(2,4,5-trichlorophenoxy)propionic acid |
| CAS: | 2-(2,4,5-trichlorophenoxy)propanoic acid |
| Reg. No.: | 93-72-1 |
| Formula: | C9H7Cl3O3 |
| Activity: | herbicides (phenoxypropionic herbicides) plant growth regulators (auxins) |
| Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example fenoprop-butometyl, fenoprop-butotyl, fenoprop-3-butoxypropyl [6047-17-2], fenoprop-butyl [13557-98-7], fenoprop-isoctyl, fenoprop-methyl [4841-20-7], fenoprop-potassium [2818-16-8]. The name “silvex” is used in the USA. The name “2,4,5-TP” is also used in France, and was used in the former USSR (2,4,5-ТП). |
| Structure: |  |
| Pronunciation: | fěn-ō-prǒp Guide to British pronunciation |
| InChIKey: | ZLSWBLPERHFHIS-UHFFFAOYSA-N |
| InChI: | InChI=1S/C9H7Cl3O3/c1-4(9(13)14)15-8-3-6(11)5(10)2-7(8)12/h2-4H,1H3,(H,13,14) |