Status: | none |
---|---|
IUPAC PIN: | (2R)-1-oxo-1-(propan-2-ylamino)propan-2-yl (3-chlorophenyl)carbamate |
IUPAC name: | (1R)-1-(isopropylcarbamoyl)ethyl (3-chlorophenyl)carbamate 1979 Rules: (R)-1-(isopropylcarbamoyl)ethyl 3-chlorocarbanilate |
CAS name: | (1R)-1-methyl-2-[(1-methylethyl)amino]-2-oxoethyl N-(3-chlorophenyl)carbamate |
CAS Reg. No.: | 1937-75-3 |
Formula: | C13H17ClN2O3 |
Activity: | herbicides (carbamate) |
Notes: | There is no ISO common name for this substance; the name “famoxacarb” has been used in the literature but it has no official status. |
Structure: | |
Pronunciation: | fǎm-ǒks-a-karb Guide to British pronunciation |
InChIKey: | WNGVKDOGSQMHII-SECBINFHSA-N |
InChI: | InChI=1S/C13H17ClN2O3/c1-8(2)15-12(17)9(3)19-13(18)16-11-6-4-5-10(14)7-11/h4-9H,1-3H3,(H,15,17)(H,16,18)/t9-/m1/s1 |
A data sheet from the Compendium of Pesticide Common Names