| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | (2Ξ)-2-ethylhexyl (2Ξ)-2-(4-chloro-2-methylphenoxy)propanoate |
| IUPAC name: | (RS)-2-ethylhexyl (RS)-2-[(4-chloro-o-tolyl)oxy]propionate |
| CAS name: | 2-ethylhexyl 2-(4-chloro-2-methylphenoxy)propanoate |
| CAS Reg. No.: | 71526-69-7 |
| Formula: | C18H27ClO3 |
| Activity: | herbicides (phenoxypropionic) |
| Notes: | This substance is a derivative of mecoprop [93-65-2]. This substance was previously known as mecoprop-2-ethylhexyl. The (+)-enantiomer of this substance has the ISO common name mecoprop-P-etexyl [861229-15-4]. |
| Structure: |  |
| Pronunciation: | měk-o-prǒp ē-těks-īl Guide to British pronunciation |
| InChIKey: | NWTKQOOQEPXMMW-UHFFFAOYSA-N |
| InChI: | InChI=1S/C18H27ClO3/c1-5-7-8-15(6-2)12-21-18(20)14(4)22-17-10-9-16(19)11-13(17)3/h9-11,14-15H,5-8,12H2,1-4H3 |