Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | 2-methylpropyl (4-chloro-2-methylphenoxy)acetate |
IUPAC name: | 2-methylpropyl (4-chloro-2-methylphenoxy)acetate 1979 Rules: isobutyl [(4-chloro-o-tolyl)oxy]acetate |
CAS name: | 2-methylpropyl 2-(4-chloro-2-methylphenoxy)acetate |
CAS Reg. No.: | 1713-11-7 |
Formula: | C13H17ClO3 |
Activity: | herbicides (phenoxyacetic) |
Notes: | This substance is a derivative of MCPA [94-74-6]. |
Structure: | |
Pronunciation: | ěm sē pē ā ī-sō-bū-tīl Guide to British pronunciation |
InChIKey: | VETMCNQKJNFMHJ-UHFFFAOYSA-N |
InChI: | InChI=1S/C13H17ClO3/c1-9(2)7-17-13(15)8-16-12-5-4-11(14)6-10(12)3/h4-6,9H,7-8H2,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names