Status: | modified ISO 1750 (published) |
---|---|
IUPAC name: | (RS)-1-[β-(allyloxy)-2,4-dichlorophenethyl]imidazole nitrate or allyl (RS)-1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl ether nitrate |
CAS name: | 1-[2-(2,4-dichlorophenyl)-2-(2-propen-1-yloxy)ethyl]-1H-imidazole nitrate (1:1) |
CAS Reg. No.: | 33586-66-2 |
Formula: | C14H15Cl2N3O4 |
Activity: | fungicides (imidazole) |
Notes: | This substance is a derivative of imazalil [35554-44-0]. The name “enilconazole nitrate” is approved by the World Health Organization. |
Structure: | |
Pronunciation: | ǐm-āz-a-lǐl nī-trāt Guide to British pronunciation |
InChIKey: | KJTYJTCKKSDSQF-UHFFFAOYSA-N |
InChI: | InChI=1S/C14H14Cl2N2O.HNO3/c1-2-7-19-14(9-18-6-5-17-10-18)12-4-3-11(15)8-13(12)16;2-1(3)4/h2-6,8,10,14H,1,7,9H2;(H,2,3,4) |
A data sheet from the Compendium of Pesticide Common Names