| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | potassium 2-(4-chlorophenyl)-3-ethyl-2,5-dihydro-5-oxopyridazine-4-carboxylate |
| CAS: | potassium 2-(4-chlorophenyl)-3-ethyl-2,5-dihydro-5-oxo-4-pyridazinecarboxylate |
| Reg. No.: | 82697-71-0 |
| Formula: | C13H10ClKN2O3 |
| Activity: | plant growth regulators (unclassified plant growth regulators) |
| Notes: | This substance is a derivative of clofencet [129025-54-3]. |
| Structure: | ![]() |
| Pronunciation: | klō-fěn-sět pa-tǎs-ē-am Guide to British pronunciation |
| InChIKey: | NUUZKOFSZIWYSC-UHFFFAOYSA-M |
| InChI: | InChI=1S/C13H11ClN2O3.K/c1-2-10-12(13(18)19)11(17)7-15-16(10)9-5-3-8(14)4-6-9;/h3-7H,2H2,1H3,(H,18,19);/q;+1/p-1 |
A data sheet from the Compendium of Pesticide Common Names