Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | rac-(2R)-1-butoxypropan-2-yl (2,4,5-trichlorophenoxy)acetate |
IUPAC name: | (RS)-2-butoxy-1-methylethyl (2,4,5-trichlorophenoxy)acetate |
CAS name: | 2-butoxy-1-methylethyl 2-(2,4,5-trichlorophenoxy)acetate |
CAS Reg. No.: | 7173-98-0 |
Formula: | C15H19Cl3O4 |
Activity: | herbicides (phenoxyacetic) |
Notes: | This substance is a derivative of 2,4,5-T [93-76-5]. |
Structure: | |
Pronunciation: | too for fīv tē bū-tō-mē-tīl Guide to British pronunciation |
InChIKey: | HDVSGSCCJZSVQP-UHFFFAOYSA-N |
InChI: | InChI=1S/C15H19Cl3O4/c1-3-4-5-20-8-10(2)22-15(19)9-21-14-7-12(17)11(16)6-13(14)18/h6-7,10H,3-5,8-9H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names