| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | potassium 2,3,6-trichlorobenzoate |
| CAS: | potassium 2,3,6-trichlorobenzoate |
| Reg. No.: | 4559-30-2 |
| Formula: | C7H2Cl3KO2 |
| Activity: | herbicides (benzoic acid herbicides) |
| Notes: | This substance is a derivative of 2,3,6-TBA [50-31-7]. The name “TCBA-potassium” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. |
| Structure: |  |
| Pronunciation: | too thrē sǐks tē bē ā pa-tǎs-ē-am Guide to British pronunciation |
| InChIKey: | KJMADHVXBWVFBX-UHFFFAOYSA-M |
| InChI: | InChI=1S/C7H3Cl3O2.K/c8-3-1-2-4(9)6(10)5(3)7(11)12;/h1-2H,(H,11,12);/q;+1/p-1 |