| Status: | none |
|---|---|
| IUPAC: | (RS)-sec-butylamine or (RS)-2-aminobutane |
| CAS: | 2-butanamine |
| Reg. No.: | 13952-84-6 |
| Formula: | C4H11N |
| Activity: | fungicides (aliphatic nitrogen fungicides) |
| Notes: | There is no ISO common name for this substance; the name “butylamine” has been used in the literature but it has no official status. |
| Structure: | ![]() |
| Pronunciation: | bū-tīl-a-mēn Guide to British pronunciation |
| InChIKey: | BHRZNVHARXXAHW-UHFFFAOYSA-N |
| InChI: | InChI=1S/C4H11N/c1-3-4(2)5/h4H,3,5H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names