| Status: | China |
|---|---|
| IUPAC: | 2-(2-butoxyethoxy)ethyl 1,3-benzodioxole-5-carboxylate or 2-(2-butoxyethoxy)ethyl piperonylate |
| CAS: | 2-(2-butoxyethoxy)ethyl 1,3-benzodioxole-5-carboxylate |
| Reg. No.: | 136-63-0 |
| Formula: | C16H22O6 |
| Activity: | synergists |
| Notes: | There is no ISO common name for this substance; the name “bucarpolate” (增效特) is approved in China, even though Bucarpolate is (or was) a registered trade mark in many countries. |
| Structure: | ![]() |
| Pronunciation: | bū-kǎrp-ō-lāt Guide to British pronunciation |
| InChIKey: | ZYVTYOMVFLAPLX-UHFFFAOYSA-N |
| InChI: | InChI=1S/C16H22O6/c1-2-3-6-18-7-8-19-9-10-20-16(17)13-4-5-14-15(11-13)22-12-21-14/h4-5,11H,2-3,6-10,12H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names