| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 4-amino-3,6-dichloropyridine-2-carboxylic acid or 4-amino-3,6-dichloropicolinic acid |
| CAS: | 4-amino-3,6-dichloro-2-pyridinecarboxylic acid |
| Reg. No.: | 150114-71-9 |
| Formula: | C6H4Cl2N2O2 |
| Activity: | herbicides (picolinic acid herbicides; pyridine herbicides) |
| Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example aminopyralid-potassium [566191-87-5], aminopyralid-tris(2-hydroxypropyl)ammonium [566191-89-7]. |
| Structure: | ![]() |
| Pronunciation: | a-mēn-ō-pīr-a-lǐd Guide to British pronunciation |
| InChIKey: | NIXXQNOQHKNPEJ-UHFFFAOYSA-N |
| InChI: | InChI=1S/C6H4Cl2N2O2/c7-3-1-2(9)4(8)5(10-3)6(11)12/h1H,(H2,9,10)(H,11,12) |
A data sheet from the Compendium of Pesticide Common Names