Status: | none |
---|---|
IUPAC PIN: | (1S,2R,4S,5R)-5-ethyl-2,4-dimethyl-6,8-dioxabicyclo[3.2.1]octane |
IUPAC name: | (1S,2R,4S,5R)-5-ethyl-2,4-dimethyl-6,8-dioxabicyclo[3.2.1]octane |
CAS name: | (1S,2R,4S,5R)-5-ethyl-2,4-dimethyl-6,8-dioxabicyclo[3.2.1]octane |
CAS Reg. No.: | 59014-03-8 |
Formula: | C10H18O2 |
Activity: | insect attractants (Coleopteran) |
Notes: | There is no ISO common name for this substance; the name “α-multistriatin” has been used in the literature but it has no official status. This substance is named after the insect from which it was isolated, Scolytus multistriatus (Marsham) (Scolytidae, Coleoptera). |
Structure: | |
Pronunciation: | ǎl-fa mǔl-tǐ-strī-a-tǐn Guide to British pronunciation |
InChIKey: | YMBRJMLOGNZRFY-UTINFBMNSA-N |
InChI: | InChI=1S/C10H18O2/c1-4-10-8(3)5-7(2)9(12-10)6-11-10/h7-9H,4-6H2,1-3H3/t7-,8+,9-,10-/m1/s1 |
A data sheet from the Compendium of Pesticide Common Names